{{Chembox | ImageFile = Coumalic acid.svg | ImageFile1 = Coumalic acid 3D structure.png | PIN = 2-Oxo-2''H''-pyran-5-carboxylic acid | OtherNames = Cumalic acid | Section1 = {{Chembox Identifiers | CASNo = 500-05-0 | CASNo_Ref = {{Cascite|correct|CAS}} | ChEBI = 180952 | ChEMBL = 216734 | ChemSpiderID = 61449 | EC_number = 207-899-0 | PubChem = 68141 | UNII = OB1JPY343G | SMILES = C1=CC(=O)OC=C1C(=O)O | InChI=1S/C6H4O4/c7-5-2-1-4(3-10-5)6(8)9/h1-3H,(H,8,9) | InChIKey = ORGPJDKNYMVLFL-UHFFFAOYSA-N }} | Section2 = {{Chembox Properties | C=6|H=4|O=4 | Appearance = yellow solid | MeltingPtC = 210 }} | Section3 = {{Chembox Hazards | GHS_ref=[https://pubchem.ncbi.nlm.nih.gov/compound/68141#section=Safety-and-Hazards] | GHSPictograms = {{GHS07}} | GHSSignalWord = Warning | HPhrases = {{H-phrases|315|319|335}} | PPhrases = {{P-phrases|261|264|264+265|271|280|302+352|304+340|305+351+338|319|321|332+317|337+317|362+364|403+233|405|501}} }} }}
'''Coumalic acid''' is an organic compound with the molecular formula C<sub>6</sub>H<sub>4</sub>O<sub>4</sub>. Its melting point is around 210 °C.<ref>{{cite journal|first1=Richard H.|last1=Wiley|first2=Louis H.|last2=Knabeschuh|title='2-Pyrones. XIII. The Chemistry of Coumalic Acid and its Derivatives|journal=Journal of the American Chemical Society|volume=77|year=1955|page=1615|doi=10.1021/ja01611a062}}</ref>
In laboratory coumalic acid may be obtained by self-condensation of malic acid in fuming sulfuric acid:<ref>{{OrgSynth | title = Coumalic acid | volume = 31 | page = 23 | year = 1951 | doi = 10.15227/orgsyn.031.0023 | author = Richard H. Wiley and Newton R. Smith}}</ref>
==References== {{Reflist}}
Category:2-Pyrones Category:Carboxylic acids