{{chembox | ImageFile = Coeloginanthrin.svg | ImageCaption = Chemical structure of coeloginanthrin | PIN = 7,8-Dimethoxyphenanthrene-2,4,6-triol | OtherNames = 3,5,7-Trihydroxy-1,2-dimethoxyphenanthrene |Section1={{Chembox Identifiers | CASNo_Ref = <ref>{{cite web |title=KNApSAcK Metabolite Information - C00033729 |url=http://www.knapsackfamily.com/knapsack_core/information.php?word=C00033729 |website=www.knapsackfamily.com}}</ref> | CASNo = 382145-13-3 | ChEBI_Ref = | ChEBI = | KEGG_Ref = | KEGG = | PubChem = 10913128 | UNII_Ref = | UNII = | EINECS = | ChemSpiderID = 9088385 | SMILES = Oc3cc(O)c2c1c(c(OC)c(OC)c(O)c1)ccc2c3 | InChI = 1/C16H14O5/c1-20-15-10-4-3-8-5-9(17)6-12(18)14(8)11(10)7-13(19)16(15)21-2/h3-7,17-19H,1-2H3 | InChIKey = RPXPLEKXBFYMQL-UHFFFAOYAE | StdInChI = 1S/C16H14O5/c1-20-15-10-4-3-8-5-9(17)6-12(18)14(8)11(10)7-13(19)16(15)21-2/h3-7,17-19H,1-2H3 | StdInChIKey = RPXPLEKXBFYMQL-UHFFFAOYSA-N | RTECS = | MeSHName = }} |Section2={{Chembox Properties | C = 16 | H = 14 | O = 5 | Appearance = | Density = | MeltingPtC = | BoilingPtC = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPtC = | AutoignitionPt = }} }}
'''Coeloginanthrin''' is a phenanthrenoid found in the orchid ''Coelogyne cristata''.<ref>{{cite journal | pmid = 11576602 | date = 2001 | last1 = Majumder | first1 = P. L. | last2 = Sen | first2 = S. | last3 = Majumder | first3 = S. | title = Phenanthrene derivatives from the orchid Coelogyne cristata | journal = Phytochemistry | volume = 58 | issue = 4 | pages = 581–586 | doi = 10.1016/s0031-9422(01)00287-4 | bibcode = 2001PChem..58..581M }}</ref>
== References == {{reflist}}
== External links == * [http://kanaya.naist.jp/knapsack_jsp/information.jsp?word=C00033729 Coeloginanthrin at kanaya.naist.jp/knapsack_jsp]
{{phenanthrenes}}
Category:Phenanthrenoids Category:Coelogyne Category:Methoxy compounds
{{phenol-stub}}