{{chembox | ImageFile = Coelogin.svg | ImageCaption = Chemical structure of coelogin | PIN = 4,5-Dimethoxy-6,7-dihydro-2''H''-naphtho[8,1,2-''cde''][1]benzopyran-3,9-diol | OtherNames = 2,6-Dihydroxy-7,8-dimethoxy-9,10-dihydro-5''H''-phenanthro[4,5-''bcd'']pyran |Section1={{Chembox Identifiers | CASNo_Ref = | CASNo = 82358-31-4 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = YXK63FJ32R | PubChem = 442697 | SMILES = COC1=C(C(=C2COC3=C4C2=C1CCC4=CC(=C3)O)O)OC | ChemSpiderID = 391053 | InChI = 1/C17H16O5/c1-20-16-10-4-3-8-5-9(18)6-12-13(8)14(10)11(7-22-12)15(19)17(16)21-2/h5-6,18-19H,3-4,7H2,1-2H3 | InChIKey = QLYYIQVXUQYKGV-UHFFFAOYAH | StdInChI = 1S/C17H16O5/c1-20-16-10-4-3-8-5-9(18)6-12-13(8)14(10)11(7-22-12)15(19)17(16)21-2/h5-6,18-19H,3-4,7H2,1-2H3 | StdInChIKey = QLYYIQVXUQYKGV-UHFFFAOYSA-N | RTECS = | MeSHName = | ChEBI = | KEGG = C10251 | EINECS = }} |Section2={{Chembox Properties | C=17|H=16|O=5 | Appearance = | Density = | MeltingPtC = | BoilingPtC = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPtC = | AutoignitionPt = }} }}
'''Coelogin''' is a phenanthrenoid found in the high altitude Himalayan orchid ''Coelogyne cristata''. This molecule has a phenanthro[4,5-''bcd'']pyran structure.<ref>{{cite journal | doi = 10.1039/P19820001131| title = Coelogin and coeloginin: Two novel 9,10-dihydrophenanthrene derivatives from the orchid Coelogyne cristata| journal = Journal of the Chemical Society, Perkin Transactions 1| pages = 1131| year = 1982| last1 = Majumder| first1 = Priyalal| last2 = Bandyopadhyay| first2 = Debabrata| last3 = Joardar| first3 = Subhendu}}</ref><ref>{{cite journal | pmid = 11576602| year = 2001| last1 = Majumder| first1 = P. L| title = Phenanthrene derivatives from the orchid Coelogyne cristata| journal = Phytochemistry| volume = 58| issue = 4| pages = 581–6| last2 = Sen| first2 = S| last3 = Majumder| first3 = S| doi=10.1016/s0031-9422(01)00287-4| bibcode = 2001PChem..58..581M}}</ref>
== References == {{reflist}}
{{phenanthrenes}}
Category:Phenanthrenoids Category:Coelogyne
{{phenol-stub}}