{{Short description|Chemical compound}} {{Drugbox | Verifiedfields = changed | verifiedrevid = 447611902 | IUPAC_name = 4-chloro-''N''-(2,6-dimethyl-1-piperidyl)-3-sulfamoyl-<br>benzamide | image = Clopamide.svg | image_class = skin-invert-image | image2 = Clopamide ball-and-stick.png | image_class2 = bg-transparent

<!--Clinical data--> | tradename = Brinaldix | Drugs.com = {{drugs.com|international|clopamide}} | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S8 --> | legal_UK = <!-- GSL / P / POM / CD --> | legal_US = <!-- OTC / Rx-only --> | legal_status = | routes_of_administration =

<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

<!--Identifiers--> | CAS_number_Ref = {{cascite|correct|??}} | CAS_number = 636-54-4 | ATC_prefix = C03 | ATC_suffix = BA03 | PubChem = 2804 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank = | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 1361347 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 2702 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 17S83WON0I | KEGG_Ref = {{keggcite|correct|kegg}} | KEGG = D02460

<!--Chemical data--> | C=14 | H=20 | Cl=1 | N=3 | O=3 | S=1 | smiles = O=C(NN1C(CCCC1C)C)c2ccc(Cl)c(c2)S(=O)(=O)N | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C14H20ClN3O3S/c1-9-4-3-5-10(2)18(9)17-14(19)11-6-7-12(15)13(8-11)22(16,20)21/h6-10H,3-5H2,1-2H3,(H,17,19)(H2,16,20,21) | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = LBXHRAWDUMTPSE-UHFFFAOYSA-N }}

'''Clopamide''' (trade name Brinaldix) is a piperidine diuretic.<ref>{{cite journal | vauthors = McNeil JJ, Conway EL, Drummer OH, Howes LG, Christophidis N, Louis WJ | title = Clopamide: plasma concentrations and diuretic effect in humans | journal = Clinical Pharmacology and Therapeutics | volume = 42 | issue = 3 | pages = 299–304 | date = September 1987 | pmid = 3621784 | doi = 10.1038/clpt.1987.151 | s2cid = 20000178 }}</ref>

==Mechanism of action== Clopamide is categorised as a thiazide-like diuretic and works in similar way as the thiazide diuretics do. It acts in the kidneys, at the distal convoluted tubule (DCT) of the nephron where it inhibits the sodium-chloride symporter. Clopamide selectively binds at the chloride binding site of the sodium-chloride symporter in the PCT cells on the luminal (interior) side and thus interferes with the reabsorption of sodium chloride, causing an equiosmolar excretion of water along with sodium chloride.

== References == <references />

{{Diuretics}}

Category:Piperidines Category:Sulfonamides Category:Hydrazides Category:Drugs developed by Novartis Category:Diuretics Category:Carbonic anhydrase inhibitors