{{Short description|Chemical compound}} {{Drugbox | IUPAC_name = Ethyl 2-<nowiki/>{4-[(2''Z'')-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]piperazin-1-yl}acetate | image = Cinepazet.svg | image_class = skin-invert-image | width = 225
<!--Clinical data--> | tradename = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_status = | routes_of_administration =
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
<!--Identifiers--> | CAS_number = 23887-41-4 | ATC_prefix = C01 | ATC_suffix = DX14 | PubChem = 6434395 | DrugBank = | ChEMBL = 2110784 | ChemSpiderID = 4939323 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 0LC95WWE9Q
<!--Chemical data--> | C=20 | H=28 | N=2 | O=6 | smiles = CCOC(=O)CN1CCN(CC1)C(=O)\C=C\c2cc(OC)c(OC)c(OC)c2 | StdInChI = 1S/C20H28N2O6/c1-5-28-19(24)14-21-8-10-22(11-9-21)18(23)7-6-15-12-16(25-2)20(27-4)17(13-15)26-3/h6-7,12-13H,5,8-11,14H2,1-4H3/b7-6+ | StdInChIKey = XDUOTWNXVDBCDY-VOTSOKGWSA-N | density = 1.172 }}
'''Cinepazet''' is a vasodilator and is an ethyl ester derivative of cinepazic acid.<ref>{{cite book | vauthors = Morton IK, Hall JM |title=Concise Dictionary of Pharmacological Agents : Properties and Synonyms |date=1999 |publisher=Springer Netherlands |location=Dordrecht |isbn=9789401144391 |page=77 | chapter = Cinepazet | chapter-url = https://books.google.com/books?id=tsjrCAAAQBAJ&dq=Cinepazet&pg=PA77 }}</ref> == References == {{Reflist}}
{{Vasodilators used in cardiac diseases}} {{Piperazines}}
Category:Alkene derivatives Category:Carboxamides Category:Ethyl esters Category:Catechol ethers Category:Piperazines Category:Vasodilators
{{cardiovascular-drug-stub}}