{{Short description|Chemical compound}} {{About|a non-clinically used progestin compound|the pharmaceutical drug|chlormadinone acetate}} {{Drugbox | IUPAC_name = (8''R'',9''S'',10''R'',13''S'',14''S'',17''R'')-17-acetyl-6-chloro-17-hydroxy-10,13-dimethyl-2,8,9,11,12,14,15,16-octahydro-1''H''-cyclopenta[''a'']phenanthren-3-one | image = Chlormadinone.svg | image_class = skin-invert-image | CAS_number = 1961-77-9 | CAS_supplemental = | UNII_Ref = {{fdacite|correct|FDA}} | UNII = SDS4N642GG | ATC_prefix = G03 | ATC_suffix = DB06 | PubChem = 5284533 | ChemSpiderID = 4447590 | C=21 | H=27 | Cl=1 | O=3 | SMILES = O=C4\C=C3\C(\Cl)=C/[C@@H]1[C@H](CC[C@@]2([C@@](O)(C(=O)C)CC[C@@H]12)C)[C@@]3(C)CC4 | StdInChI = 1S/C21H27ClO3/c1-12(23)21(25)9-6-16-14-11-18(22)17-10-13(24)4-7-19(17,2)15(14)5-8-20(16,21)3/h10-11,14-16,25H,4-9H2,1-3H3/t14-,15+,16+,19-,20+,21+/m1/s1 | StdInChIKey = VUHJZBBCZGVNDZ-TTYLFXKOSA-N | synonyms = Chlordione; 17α-Hydroxy-6-chloro-6-dehydroprogesterone; 17α-Hydroxy-6-chloropregna-4,6-diene-3,20-dione; 6-Chloro-17α-hydroxypregna-4,6-diene-3,20-dione | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | pregnancy_category = | legal_status = | routes_of_administration = }}

'''Chlormadinone''' is a progestin which was never marketed.<ref name="Macdonald1997">{{cite book | vauthors = Macdonald F | title = Dictionary of Pharmacological Agents | url = https://books.google.com/books?id=DeX7jgInYFMC&pg=PA419 | access-date = 29 May 2012 | year = 1997 | publisher = CRC Press | isbn = 978-0-412-46630-4 | page = 419}}</ref><ref name="IndexNominum2000">{{cite book | title = Index Nominum 2000: International Drug Directory | url = https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA215 | access-date = 29 May 2012 | year = 2000 | publisher = Taylor & Francis US | isbn = 978-3-88763-075-1 | page = 215}}</ref> An acylated derivative, chlormadinone acetate, is used clinically as a pharmaceutical drug.<ref name="Macdonald1997" /><ref name="IndexNominum2000" />

<!-- Society and culture --> It was patented in 1958 and approved for medical use in 1963.<ref name=Fis2006>{{cite book | vauthors = Fischer J, Ganellin CR |title=Analogue-based Drug Discovery |date=2006 |publisher=John Wiley & Sons |isbn=9783527607495 |page=478 |url=https://books.google.com/books?id=FjKfqkaKkAAC&pg=PA478 |language=en}}</ref> While ''chlormadinone'' is sometimes used as a synonym for ''chlormadinone acetate'', what is almost always being referred to is chlormadinone acetate and not chlormadinone.

==See also== * List of progestogens

==References== {{Reflist}}

{{Progesterone receptor modulators}}

Category:Abandoned drugs Category:Enones Category:Organochlorides Category:Conjugated dienes Category:Diketones Category:Pregnanes Category:Progestogens Category:Tertiary alcohols

{{Genito-urinary-drug-stub}} {{Pregnanes-stub}}