{{Short description|Chemical compound}} {{Drugbox | Watchedfields = changed | verifiedrevid = 443508077 | IUPAC_name = (6''R'',7''R'')-7-{[(2''R'')-2-hydroxy-2-phenylacetyl]amino}-<br />3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-<br />5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic&nbsp;acid | image = Cefamandole.svg | image_class = skin-invert-image <!--Clinical data--> | tradename = former Mandol | Drugs.com = {{drugs.com|CONS|cefamandole}} | MedlinePlus = a601206 | pregnancy_AU = B1 | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_UK = POM | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_US_comment = Discontinued | routes_of_administration = Intramuscular, intravenous <!--Pharmacokinetic data--> | bioavailability = | protein_bound = 75% | metabolism = | elimination_half-life = 48 minutes | excretion = Mostly renal, as unchanged drug <!--Identifiers--> | CAS_number_Ref = {{cascite|correct|??}} | CAS_number = 34444-01-4 | CAS_supplemental = {{CAS|42540-40-9}} | ATC_prefix = J01 | ATC_suffix = DC03 | PubChem = 456255 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank = DB01326 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 401748 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 5CKP8C2LLI | KEGG_Ref = {{keggcite|correct|kegg}} | KEGG = D02344 | ChEBI_Ref = {{ebicite|correct|EBI}} | ChEBI = 3480 | ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL = 1146 <!--Chemical data--> | C=18 | H=18 | N=6 | O=5 | S=2 | smiles = O=C2N1/C(=C(\CS[C@@H]1[C@@H]2NC(=O)[C@H](O)c3ccccc3)CSc4nnnn4C)C(=O)O | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C18H18N6O5S2/c1-23-18(20-21-22-23)31-8-10-7-30-16-11(15(27)24(16)12(10)17(28)29)19-14(26)13(25)9-5-3-2-4-6-9/h2-6,11,13,16,25H,7-8H2,1H3,(H,19,26)(H,28,29)/t11-,13-,16-/m1/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = OLVCFLKTBJRLHI-AXAPSJFSSA-N }} '''Cefamandole''' (INN, also known as '''cephamandole''') is a second-generation broad-spectrum cephalosporin antibiotic. The clinically used form of cefamandole is the formate ester '''cefamandole nafate''', a prodrug which is administered parenterally. Cefamandole is no longer available in the United States.

The chemical structure of cefamandole, like that of several other cephalosporins, contains an ''N''-methylthiotetrazole (NMTT or 1-MTT) side chain. As the antibiotic is broken down in the body, it releases free NMTT, which can cause hypoprothrombinemia (likely due to inhibition of the enzyme vitamin K epoxide reductase) and a reaction with ethanol similar to that produced by disulfiram (Antabuse), due to inhibition of aldehyde dehydrogenase. Vitamin K supplement is recommended during therapy, and consumption of ethanol and ethanol-containing substances is discouraged.

Cefamandole has a broad spectrum of activity and can be used to treat bacterial infections of the skin, bones and joints, urinary tract, and lower respiratory tract. The following represents cefamandole MIC susceptibility data for a few medically significant microorganisms. * ''Escherichia coli'': 0.12 - 400 μg/ml * ''Haemophilus influenzae'': 0.06 - >16 μg/ml * ''Staphylococcus aureus'': 0.1 - 12.5 μg/ml<ref>{{cite web | url = http://www.toku-e.com/Assets/MIC/Cefamandole%20sodium%20salt.pdf | title = Cefamandole sodium salt Susceptibility and 0.5 - 32 Minimum Inhibitory Concentration (MIC) Data | work = The Antimicrobial Index | publisher = TOKU-E | date = 6 January 2020 }}</ref>

CO<sub>2</sub> is generated during the normal constitution of cefamandole and ceftazidime, potentially resulting in an explosive-like reaction in syringes.<ref name=Goldfrank>{{cite book | vauthors = Stork CM |veditors=Nelson LH, Flomenbaum N, Goldfrank LR, Hoffman RL, Howland MD, Lewin NA |title=Goldfrank's toxicologic emergencies |chapter=Antibiotics, antifungals, and antivirals |chapter-url=https://books.google.com/books?id=cvJuLqBxGUcC&pg=PA847 |publisher=McGraw-Hill |location=New York |year=2006 |pages=847 |isbn=0-07-143763-0 |access-date=2009-07-03}}</ref>

==See also== *Cefazolin *Ceforanide

== References == {{Reflist}}

{{CephalosporinAntiBiotics}}

Category:Acetaldehyde dehydrogenase inhibitors Category:Cephalosporin antibiotics Category:Enantiopure drugs Category:Phenylethanolamines Category:Tetrazoles