{{Chembox | ImageFile = Campestane.svg | ImageSize = 200px | ImageAlt = | IUPACName = 5ξ-Campestane<ref>{{cite book |author=International Union of Pure and Applied Chemistry |date=2014 |title=Nomenclature of Organic Chemistry: IUPAC Recommendations and Preferred Names 2013 |publisher=The Royal Society of Chemistry |pages=1528 |doi=10.1039/9781849733069 |isbn=978-0-85404-182-4}}</ref> | SystematicName = (1''R'',3a''S'',3b''R'',5a''Ξ'',9a''S'',9b''S'',11a''R'')-1-[(2''R'',5''R'')-5,6-Dimethylheptan-2-yl]-9a,11a-dimethylhexadecahydro-1''H''-cyclopenta[''a'']phenanthrene | OtherNames = |Section1={{Chembox Identifiers | index1_label = 5α-Campestane | CASNo1 = 50897-35-3 | PubChem = 6857532 | Beilstein = | KEGG = | ChEBI = 35518 | StdInChI= 1S/C28H50/c1-19(2)20(3)10-11-21(4)24-14-15-25-23-13-12-22-9-7-8-17-27(22,5)26(23)16-18-28(24,25)6/h19-26H,7-18H2,1-6H3/t20-,21-,22?,23+,24-,25+,26+,27+,28-/m1/s1 | StdInChIKey= WAAWMJYYKITCGF-SULSJXDKSA-N | SMILES = C[C@H](CC[C@@H](C)C(C)C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4[C@@]3(CCCC4)C)C | ChemSpiderID = 5256868 }} |Section2={{Chembox Properties | C=28 | H=50 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}

'''Campestane''' or '''24''R''-methylcholestane''' is a tetracyclic triterpene.<ref>{{Cite journal| vauthors= Yakimchyk VS, Kazlova VV, Hurski AL, Savchenko RG, Kostyleva SA, Zhabinskii VN, Khripach VA | title = Enantioselective catalytic approach to the C23-C28 subunit of 24α-methyl steroids | journal = Steroids | year = 2019 | volume = 148 | pages = 82–90 | doi = 10.1016/j.steroids.2019.05.003 | pmid = 31100291 | s2cid = 153311334 }}</ref> Its derivative campesterol (campest-5-en-3β-ol) was first isolated from the rapeseed (''Brassica campestris''), hence the name.<ref>{{cite journal |doi=10.1021/ja01849a079 |year=1941 |last1=Fernholz |first1=Erhard |title=Isolation of a New Phytosterol: Campesterol |last2=MacPhillamy |first2=H. B. |journal=Journal of the American Chemical Society |volume=63 |issue=4 |pages=1155}}</ref>

==See also== * Cholestane * Ergostane (24''S''-methylcholestane) * Campestanol (Campestan-3β-ol)

==References== {{Reflist}}

Category:Triterpenes