{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 462806316 | Name = Butein | ImageFile = Butein.svg | ImageSize = 250px | ImageName = Chemical structure of butein | PIN = 2′,3,4,4′-Tetrahydroxychalcone | OtherNames = (2''E'')-1-(2,4-Dihydroxyphenyl)-3-(3,4-dihydroxyphenyl)prop-2-en-1-one<br>2′,4′,3,4-Tetrahydroxychalcone<br>3,4,2′,4′-Tetrahydroxychalcone |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|CAS}} | CASNo = 487-52-5 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 4WVS5M0LGF | PubChem = 5281222 | KEGG = C08578 | ChEBI = 3237 | ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL = 128000 | SMILES = C1=CC(=C(C=C1C=CC(=O)C2=C(C=C(C=C2)O)O)O)O | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 4444634 | InChI = 1/C15H12O5/c16-10-3-4-11(14(19)8-10)12(17)5-1-9-2-6-13(18)15(20)7-9/h1-8,16,18-20H/b5-1+ | InChIKey = AYMYWHCQALZEGT-ORCRQEGFBV | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C15H12O5/c16-10-3-4-11(14(19)8-10)12(17)5-1-9-2-6-13(18)15(20)7-9/h1-8,16,18-20H/b5-1+ | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = AYMYWHCQALZEGT-ORCRQEGFSA-N | MeSHName = }} |Section2={{Chembox Properties | C=15 | H=12 | O=5 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} }}

'''Butein''' is a chalcone of the chalconoids. It can be found in ''Toxicodendron vernicifluum'' (or formerly ''Rhus verniciflua''), ''Dahlia'', ''Butea'' (''Butea monosperma'') and ''Coreopsis''.<ref>Semwal, R. B., Semwal, D. K., Combrinck, S., & Viljoen, A. (2015). Butein: From ancient traditional remedy to modern nutraceutical. Phytochemistry Letters, 11, 188-201. {{doi|10.1016/j.phytol.2014.12.014}}</ref> It has antioxidative, aldose reductase and advanced glycation endproducts inhibitory effects.<ref name="pmid18670102">{{cite journal |vauthors=Lee EH, Song DG, Lee JY, Pan CH, Um BH, Jung SH |title=Inhibitory effect of the compounds isolated from Rhus verniciflua on aldose reductase and advanced glycation endproducts |journal=Biol. Pharm. Bull. |volume=31 |issue=8 |pages=1626–30 |date=August 2008 |pmid=18670102 |doi= 10.1248/bpb.31.1626|doi-access=free }}</ref> It is also a sirtuin-activating compound, a chemical compound having an effect on sirtuins, a group of enzymes that use NAD<sup>+</sup> to remove acetyl groups from proteins. Buteins possess a high ability to inhibit aromatase process in the human body, for this reason, the use of these compounds in the treatment of breast cancer on the estrogen ground has been explored.<ref>Wang Y. "[https://www.ncbi.nlm.nih.gov/pubmed/15848217 The plant polyphenol butein inhibits testosterone-induced proliferation in breast cancer cells expressing aromatase]" Life Sci. 2005 May 20;77(1):39-51.</ref> The first attempts of sport pro-hormone supplementation with the use of buteins took place in Poland.<ref>S.Amboziak "[http://prohormones.info/aromatase.htm Aromatase in the dock"] 09.2012</ref>{{rs|date=March 2024}}

==References== {{reflist}}

{{chalconoid}}

Category:Chalconoids

{{aromatic-stub}}