{{short description|Cough suppressant}} {{Drugbox | verifiedrevid = 447812394 | IUPAC_name = 2-(2-diethylaminoethoxy)ethyl 2-phenylbutanoate | image = Butamirate-no-terminal-H.svg | image_class = skin-invert-image
<!--Clinical data--> | tradename = Acodeen, Codesin, Pertix, Sinecod, Sinecoden, Sinecodix | Drugs.com = {{drugs.com|international|butamirate}} | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
<!--Pharmacokinetic data--> | protein_bound = 98% | elimination_half-life = 6 hours | excretion = 90% renal
<!--Identifiers--> | CAS_number_Ref = {{cascite|correct|??}} | CAS_number = 18109-80-3 | ATC_prefix = R05 | ATC_suffix = DB13 | PubChem = 28892 | ChEMBL = 1332546 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank = DB13731 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 26873 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = M75MZG2236 | KEGG_Ref = {{keggcite|correct|kegg}} | KEGG = D07594
<!--Chemical data--> | C=18 | H=29 | N=1 | O=3 | smiles = O=C(OCCOCCN(CC)CC)C(c1ccccc1)CC | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C18H29NO3/c1-4-17(16-10-8-7-9-11-16)18(20)22-15-14-21-13-12-19(5-2)6-3/h7-11,17H,4-6,12-15H2,1-3H3 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = DDVUMDPCZWBYRA-UHFFFAOYSA-N }} '''Butamirate''' (or '''brospamin''', trade names '''Acodeen''', '''Codesin''', '''Pertix''', '''Sinecod''', '''Sinecoden''', '''Sinecodix''') is a cough suppressant.<ref>{{cite journal | vauthors = Germouty J, Weibel MA | title = [Clinical comparison of butamirate citrate with a codeine-based antitussive agent] | journal = Revue Médicale de la Suisse Romande | volume = 110 | issue = 11 | pages = 983–6 | date = November 1990 | pmid = 1980027 }}</ref> It has been marketed in Europe and Mexico, but not in the United States.<ref name="abroad">{{cite book |isbn=0-8103-7177-4 |title=Drugs Available Abroad, 1st Edition |pages=29–30 |date=1991 | vauthors = Schlesser JL |publisher=Derwent Publications Ltd.}}</ref>
It is sold in the form of lozenges, syrup, tablets, dragées, or pastilles as the citrate salt. Adverse effects can include nausea, diarrhea, vertigo, and exanthema.<ref name="abroad"/>
==Pharmacology== A study found it to bind to the cough center in the medulla oblongata, more specifically the dextromethorphan-binding site in guinea pig brain with high affinity.<ref>{{cite journal | vauthors = Klein M, Musacchio JM | title = High affinity dextromethorphan binding sites in guinea pig brain. Effect of sigma ligands and other agents | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 251 | issue = 1 | pages = 207–15 | date = October 1989 | pmid = 2477524 }}</ref>
As a 2-(2-diethylaminoethoxy)ethyl ester, it is chemically related to oxeladin and pentoxyverine, which are in the same class. (Oxeladin has an additional ethyl group in its carboxylic acid, pentoxyverine has both ethyl groups of oxeladin replaced by one cyclopentyl in the same place.)
<div class="skin-invert-image"><gallery> File:Oxeladin.png|Oxeladin File:Pentoxyverine skeletal.svg|Pentoxyverine </gallery></div>
== See also == * Cough syrup * Noscapine * Codeine; Pholcodine * Dextromethorphan; Dimemorfan * Racemorphan; Dextrorphan; Levorphanol * Pentoxyverine * Tipepidine * Cloperastine; Levocloperastine
== References == {{reflist}}
{{Cough and cold preparations}}
Category:Antitussives Category:Diethylamino compounds Category:Carboxylate esters Category:Glycol ethers Category:Sigma agonists