{{Short description|Medication}} {{Drugbox | image = Buphenine.svg | image_class = skin-invert-image | width =
<!-- Clinical data --> | tradename = Arlidin | Drugs.com = {{drugs.com|international|buphenine}} | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_status = | routes_of_administration =
<!-- Pharmacokinetic data --> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
<!-- Identifiers --> | CAS_number = 447-41-6 | ATC_prefix = C04 | ATC_suffix = AA02 | ATC_supplemental = {{ATC|G02|CA02}} | PubChem = 4567 | DrugBank = | ChemSpiderID = 4407 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 695DKH33EI | ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL = 114655 | synonyms = Nylidrin
<!-- Chemical data --> | IUPAC_name = 4-<nowiki>{1-hydroxy-2-[(1-methyl-3-phenylpropyl)amino]propyl}phenol</nowiki> | C=19 | H=25 | N=1 | O=2 | SMILES = OC(c1ccc(O)cc1)C(NC(C)CCc2ccccc2)C }}
'''Buphenine''', also known as '''nylidrin''' and sold under the brand name '''Arlidin''', is a β<sub>2</sub> adrenoreceptor agonist<ref name="pmid2857689">{{cite journal |vauthors=Mittag TW, Tormay A, Messenger M, Podos SM |title=Ocular hypotension in the rabbit. Receptor mechanisms of pirbuterol and nylidrin |journal=Invest Ophthalmol Vis Sci |volume=26 |issue=2 |pages=163–9 |date=February 1985 |pmid=2857689 |url=http://www.iovs.org/cgi/pmidlookup?view=long&pmid=2857689 |url-status=dead |archiveurl=https://archive.today/20130415011509/http://www.iovs.org/cgi/pmidlookup?view=long&pmid=2857689 |archivedate=2013-04-15 }}</ref> that acts as a vasodilator.<ref>{{cite journal| vauthors=Freedman L| title=Arlidin: a new vasodilative sympathomimetic drug | journal=Angiology | year= 1955 | volume= 6 | issue= 1 | pages= 52–8 | pmid=14350296 | doi=10.1177/000331975500600106| s2cid=46317963 }}</ref>
It was developed as a chemical derivative of oxilofrine, and first reported in the literature in 1950.<ref>{{cite journal| vauthors=Külz F, Schneider M| title=Über neue gefäßerweiternde Sympathomimetika |language=German |trans-title=On new vasodilative sympathomimetics | journal=Klin Wochenschr | year= 1950 | volume= 28 | issue=31–32 | pages= 535–7| doi=10.1007/BF01481535 | pmid=14775050 }}</ref>
==See also== * Isoxsuprine
==References== {{Reflist}}
{{Other gynecologicals}} {{Peripheral vasodilators}} {{Adrenergic receptor modulators}} {{Ionotropic glutamate receptor modulators}}
Category:Beta-Hydroxyamphetamines Category:Beta2-adrenergic agonists Category:NMDA receptor antagonists Category:4-Hydroxyphenyl compounds Category:Tocolytics
{{cardiovascular-drug-stub}} {{genito-urinary-drug-stub}} Category:Cerebral vasodilators