Bufalin

{{Chembox  | ImageFile = Bufalin.svg | ImageSize = 200px | ImageAlt =  | IUPACName = 3β,14-Dihydroxy-5β-bufa-20,22-dienolide | SystematicName = 4-[(1''R'',3a''S'',3b''R'',5a''R'',7''S'',9a''S'',9b''S'',11a''R'')-3a,7-Dihydroxy-9a,11a-dimethylhexadecahydro-1''H''-cyclopenta[''a'']phenanthren-1-yl]-2''H''-pyran-2-one | OtherNames =  | Section1 = {{Chembox Identifiers | CASNo = 465-21-4 | PubChem = 9547215 | ChemSpiderID = 7826155 | ChEBI = 517248 | ChEMBL = 399680 | UNII = U549S98QLW | SMILES = C[C@]12CC[C@@H](C[C@H]1CC[C@@H]3[C@@H]2CC[C@]4([C@@]3(CC[C@@H]4c5ccc(=O)oc5)O)C)O | StdInChI=1S/C24H34O4/c1-22-10-7-17(25)13-16(22)4-5-20-19(22)8-11-23(2)18(9-12-24(20,23)27)15-3-6-21(26)28-14-15/h3,6,14,16-20,25,27H,4-5,7-13H2,1-2H3/t16-,17+,18-,19+,20-,22+,23-,24+/m1/s1 | StdInChIKey = QEEBRPGZBVVINN-BMPKRDENSA-N }} | Section2 = {{Chembox Properties | C=24|H=34|O=4 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} | Section3 = {{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = | GHSSignalWord = Danger | GHSPictograms = {{GHS06}} | HPhrases = {{H-phrases|300}} | PPhrases = {{P-phrases|264|270|301+310|321|330|405|501}} }} }}

'''Bufalin''' is a cardiotonic steroid toxin<ref>{{cite journal | journal = Ther Drug Monit | date = 1998 | volume = 20 | issue = 1 | pages = 104–108 | doi = 10.1097/00007691-199802000-00019 | title = Rapid detection of cardioactive bufalin toxicity using fluorescence polarization immunoassay for digitoxin | author = A Dasgupta, P Datta | pmid = 9485564 }}</ref> originally isolated from Chinese toad venom, which is a component of some traditional Chinese medicines.<ref name="santacruz">{{cite web | title = Datasheet: Bufotalin sc-sc-200136 | publisher = Santa Cruz Biotechnology, Inc. | url = https://datasheets.scbt.com/sc-200136.pdf }}</ref><ref name=Okada1960>{{cite journal |last1=Okada |first1=Masahiro |last2=Suga |first2=Toshiro |display-authors=etal |date=April 1960 |title=Pharmacology of the principles isolated from Senso (Ch'an Su) the dried venom of the Chinese toad (IV) |url=http://www.med.or.jp/english/journal/amj/0304/0304.pdf |journal=Asian Medical Journal |volume=3 |issue=4 |pages=155–160 |archive-date=2017-04-27 |access-date=2017-04-27 |archive-url=https://web.archive.org/web/20170427192602/http://www.med.or.jp/english/journal/amj/0304/0304.pdf |url-status=dead }}</ref>

==Research==

Bufalin has ''in vitro'' antitumor effects against various malignant cell lines, including hepatocellular<ref name=" pmid = 24581171 ">{{cite journal | author = Zhang ZJ | title = Bufalin attenuates the stage and metastatic potential of hepatocellular carcinoma in nude mice. | journal = J Transl Med | volume = 12 |date=Feb 2014 | pmid = 24581171 | doi = 10.1186/1479-5876-12-57 | pmc=4015709 | pages=57 | doi-access = free }}</ref> and lung carcinoma.<ref name=" pmid = 24871662 ">{{cite journal | author = Wu SH | title = Bufalin induces cell death in human lung cancer cells through disruption of DNA damage response pathways | journal = Am J Chin Med | volume = 42 | issue = 3|date= 2014 | pmid = 24871662 | doi = 10.1142/S0192415X14500475 | pages=729–42}}</ref> However, as with other bufadienolides, its potential use is hampered by its cardiotoxicity.<ref name=" pmid = 21084181 ">{{cite journal | author = Ma H | title = The novel antidote Bezoar Bovis prevents the cardiotoxicity of Toad (''Bufo bufo gargarizans'' Canto) Venom in mice | journal = Exp Toxicol Pathol. | volume = 64 | issue = 5|date=Jul 2012 | pmid = 21084181 | doi = 10.1016/j.etp.2010.10.007 | pages=417–23}}</ref>

==References== {{Reflist}}

Category:Bufanolides Category:Cardiac stimulants Category:Toxins