{{Short description|Medication}} {{Drugbox | Verifiedfields = | Watchedfields = | verifiedrevid = | IUPAC_name = 3-[(6a''R'',9''S'')-5-bromo-7-methyl-6,6a,8,9-tetrahydro-4''H''-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea | image = Bromerguride.svg | image_class = skin-invert-image | width = 225px | image2 = Bromerguride 3D.png | image_class2 = bg-transparent | width2 = 225px
<!--Clinical data--> | tradename = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = | class =
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
<!-- Identifiers --> | CAS_number_Ref = | CAS_number = 83455-48-5 | CAS_supplemental = | ATC_prefix = | ATC_suffix = | ATC_supplemental = | PubChem = 71266 | IUPHAR_ligand = | DrugBank_Ref = | DrugBank = | ChemSpiderID_Ref = | ChemSpiderID = 64394 | UNII = HX58M2377W | KEGG = | ChEBI = | ChEMBL = 2104211 | synonyms = 2-Bromolisuride; 2-Br-LIS; Βromolisuride; Bromuride; ZK-95451; 3-(2-Βromo-9,10-didehydro-6-methyl-8α-ergolinyl)-1,1-diethylurea
<!--Chemical data--> | C=20 | H=25 | Br=1 | N=4 | O=1 | SMILES = CCN(CC)C(=O)N[C@@H]1CN([C@@H]2CC3=C(NC4=CC=CC(=C34)C2=C1)Br)C | StdInChI_Ref = | StdInChI = 1S/C20H25BrN4O/c1-4-25(5-2)20(26)22-12-9-14-13-7-6-8-16-18(13)15(19(21)23-16)10-17(14)24(3)11-12/h6-9,12,17,23H,4-5,10-11H2,1-3H3,(H,22,26)/t12-,17+/m0/s1 | StdInChIKey_Ref = | StdInChIKey = SBHNNNRQZGYOAU-YVEFUNNKSA-N }}
'''Bromerguride''' ({{Abbrlink|INN|International Nonproprietary Name}}), also known as '''2-bromolisuride''', is an antidopaminergic and serotonergic agent of the ergoline group which was described as having atypical antipsychotic properties but was never marketed.<ref name="pmid6607392">{{cite journal | vauthors = Wachtel H, Kehr W, Sauer G | title = Central antidopaminergic properties of 2-bromolisuride, an analogue of the ergot dopamine agonist lisuride | journal = Life Sci | volume = 33 | issue = 26 | pages = 2583–97 | date = December 1983 | pmid = 6607392 | doi = 10.1016/0024-3205(83)90342-9 | url = }}</ref><ref name="pmid3803415">{{cite journal | vauthors = Krause W, Sauerbrey N, Gräf KJ | title = Pharmacokinetics and pharmacodynamics in man of the dopamine antagonist ergot derivative, bromerguride | journal = Eur J Clin Pharmacol | volume = 31 | issue = 2 | pages = 165–8 | date = 1986 | pmid = 3803415 | doi = 10.1007/BF00606653 | s2cid = 25185807 | url = }}</ref><ref name="pmid1905409">{{cite journal | vauthors = Fink H, Morgenstern R, Ott T | title = 2-Bromolisuride, an ergot derivative, with dopamine antagonistic and serotonin agonistic properties | journal = Pharmacol Biochem Behav | volume = 38 | issue = 2 | pages = 321–5 | date = February 1991 | pmid = 1905409 | doi = 10.1016/0091-3057(91)90285-a | s2cid = 46024181 | url = }}</ref><ref name="pmid9369342">{{cite journal | vauthors = Assié MB, Cosi C, Koek W | title = 5-HT<sub>1A</sub> receptor agonist properties of the antipsychotic, nemonapride: comparison with bromerguride and clozapine | journal = Eur J Pharmacol | volume = 334 | issue = 2–3 | pages = 141–7 | date = September 1997 | pmid = 9369342 | doi = 10.1016/s0014-2999(97)01207-7 | url = }}</ref><ref name="pmid1354031">{{cite journal | vauthors = Löschmann PA, Horowski R, Wachtel H | title = Bromerguride--an ergoline derivative with atypical neuroleptic properties | journal = Clin Neuropharmacol | volume = 15 Suppl 1 Pt A | issue = | pages = 263A–264A | date = 1992 | pmid = 1354031 | doi = 10.1097/00002826-199201001-00137 | s2cid = 34842719 | url = }}</ref> It was the first antidopaminergic ergoline derivative to be discovered.<ref name="pmid6607392" /> The pharmacodynamic actions of bromerguride are said to be "reversed"{{jargon-inline|date=April 2021}} relative to its parent compound lisuride, a dopaminergic agent.<ref name="pmid3609071">{{cite journal | vauthors = Hilderbrand M, Hümpel M, Krause W, Täuber U | title = Pharmacokinetics of bromerguride, a new dopamine-antagonistic ergot derivative in rat and dog | journal = Eur J Drug Metab Pharmacokinet | volume = 12 | issue = 1 | pages = 31–40 | date = 1987 | pmid = 3609071 | doi = 10.1007/BF03189859 | s2cid = 22838914 | url = }}</ref>
==See also== * Substituted ergoline
==References== {{Reflist}}
{{Dopamine receptor modulators}} {{Serotonin receptor modulators}} {{Ergolines}}
Category:Abandoned drugs Category:Atypical antipsychotics Category:Bromoarenes Category:Dopamine antagonists Category:Ergolines Category:Serotonin receptor antagonists Category:Serotonin receptor agonists Category:Ureas
{{Nervous-system-drug-stub}}