{{Short description|Chemical compound}} {{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 443554130 | IUPAC_name = (8''R'',9''S'',10''R'',13''S'',14''S'',17''S'')-17-ethyl-13-methyl-2,3,4,7,8,9,10,11,12,14,15, 16-dodecahydro-1''H''-cyclopenta[''a'']phenanthren-17-ol | image = Bolenol.png | image_class = skin-invert-image | width = 200px
<!--Clinical data--> | tradename = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = By mouth
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
<!-- Identifiers --> | CAS_number_Ref = {{cascite|correct|??}} | CAS_number = 16915-78-9 | CAS_supplemental = | ATC_prefix = | ATC_suffix = | ATC_supplemental = | PubChem = 11954311 | IUPHAR_ligand = | DrugBank_Ref = | DrugBank = | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 10128606 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 1BBD3123X6 | KEGG = | ChEBI = | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 2104166 | synonyms = Ethylnorandrostenol; 17α-Ethyl-19-norandrost-5-en-17β-ol
<!--Chemical data--> | C=20 | H=32 | O=1 | SMILES = CC[C@@]1(CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@H]3CCCC4)C)O | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C20H32O/c1-3-20(21)13-11-18-17-9-8-14-6-4-5-7-15(14)16(17)10-12-19(18,20)2/h8,15-18,21H,3-7,9-13H2,1-2H3/t15-,16+,17+,18-,19-,20-/m0/s1 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = VGXLQFPZGUQVQW-XGXHKTLJSA-N }}
'''Bolenol''' ({{abbrlink|INN|International Nonproprietary Name}}, {{abbrlink|USAN|United States Adopted Name}}), also known as '''17α-ethyl-19-norandrost-5-en-17β-ol''' ('''ethylnorandrostenol'''), is a synthetic, orally active anabolic-androgenic steroid (AAS) and a 17α-alkylated derivative of 19-nortestosterone (nandrolone) that was never marketed.<ref name="Elks2014">{{cite book | vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA168|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=168–}}</ref> It was described in the literature in 1969.<ref name="Elks2014" />
For the synthesis of Bolenol consult the Cingestol page. ==See also== * Bolandiol * Methandriol * Propetandrol * Penmesterol
==References== {{Reflist}}
{{Androgen receptor modulators}}
Category:1-Ethylcyclopentanols Category:Androgens Category:Estranes Category:Hepatotoxins
{{Androgen-stub}} {{Estrane-stub}} {{Genito-urinary-drug-stub}} Category:Abandoned drugs