{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 462805586 | ImageFile=Blasticidin S.svg | ImageClass = skin-invert-image | ImageSize=270px | PIN=(2''S'',3''S'',6''R'')-3-{(3''S'')-3-Amino-5-[carbamimidoyl(methyl)amino]pentanamido}-6-(4-amino-2-oxopyrimidin-1(2''H'')-yl)-3,6-dihydro-2''H''-pyran-2-carboxylic acid | OtherNames= |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|??}} | CASNo=2079-00-7 | CASNo1_Ref = {{cascite|correct|CAS}} | CASNo1 = 3513-03-9 | CASNo1_Comment = (hydrochloride salt) | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 83U64J9U23 | PubChem=258 | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 15353 | ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL = 476894 | KEGG_Ref = {{keggcite|correct|kegg}} | KEGG = C02010 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 148673 | SMILES = O=C1\N=C(\N)/C=C\N1[C@@H]\2O[C@H](C(=O)O)[C@H](/C=C/2)NC(=O)C[C@@H](N)CCN(C(=[N@H])N)C | InChI = 1/C17H26N8O5/c1-24(16(20)21)6-4-9(18)8-12(26)22-10-2-3-13(30-14(10)15(27)28)25-7-5-11(19)23-17(25)29/h2-3,5,7,9-10,13-14H,4,6,8,18H2,1H3,(H3,20,21)(H,22,26)(H,27,28)(H2,19,23,29)/t9-,10-,13+,14-/m0/s1 | InChIKey = CXNPLSGKWMLZPZ-ZNIXKSQXBS | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C17H26N8O5/c1-24(16(20)21)6-4-9(18)8-12(26)22-10-2-3-13(30-14(10)15(27)28)25-7-5-11(19)23-17(25)29/h2-3,5,7,9-10,13-14H,4,6,8,18H2,1H3,(H3,20,21)(H,22,26)(H,27,28)(H2,19,23,29)/t9-,10-,13+,14-/m0/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = CXNPLSGKWMLZPZ-ZNIXKSQXSA-N }} |Section2={{Chembox Properties | C=17 | H=26 | N=8 | O=5 | MolarMass=422.44 g/mol | Appearance= | Density= | MeltingPt= | BoilingPt= | Solubility= }} |Section3={{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt = }} }}

'''Blasticidin S''' is an antibiotic that is used in biology research for selecting cells in cell culture. Cells of interest can express the blasticidin resistance genes BSD or bsr, and can then survive treatment with the antibiotic. Blasticidin S is a nucleoside analogue antibiotic, resembling the nucleoside cytidine. Blasticidin works against human cells, fungi, and bacteria, all by disrupting protein translation. It was originally described by Japanese researchers in the 1950s seeking antibiotics for rice blast fungus.

== Chemistry == thumb|Color overlay showing constituent parts of Blasticidin S|upright=1.4 A nucleoside analog, blasticidin S resembles the nucleoside cytidine. The chemical structure consists of a cytosine molecule, linked to a glucuronic acid-derived ring, linked in turn to the peptide N-methyl β-arginine.<ref name=Niu2015>{{cite journal |vauthors=Niu G, Tan H |title=Nucleoside antibiotics: biosynthesis, regulation, and biotechnology |journal=Trends Microbiol |volume=23 |issue=2 |pages=110–9 |date=February 2015 |pmid=25468791 |doi=10.1016/j.tim.2014.10.007 }}</ref>

== Uses == Blasticidin S is widely used in cell culture for selecting and maintaining genetically manipulated cells. Cells of interest express the blasticidin S resistance genes BSD or bsr, and can then survive blasticidin S being added to the culture media.<ref name=TF/> Blasticidin S is typically used at 2–300 micrograms per milliliter of media, depending on the type of cell being grown.<ref name=TF/>

== Mechanism of action == Blasticidin prevents the growth of both eukaryotic and prokaryotic cells. It works by inhibiting termination step of translation and peptide bond formation (to lesser extent) by the ribosome. This means that cells can no longer produce new proteins through translation of mRNA. It is competitive with puromycin suggesting a highly similar binding site.<ref name="Cone2003">{{cite journal | last1=Cone | first1=Martha C. | last2=Yin | first2=Xihou | last3=Grochowski | first3=Laura L. | last4=Parker | first4=Morgan R. | last5=Zabriskie | first5=T. Mark | title=The Blasticidin S Biosynthesis Gene Cluster from Streptomyces griseochromogenes: Sequence Analysis, Organization, and Initial Characterization | journal=ChemBioChem | publisher=Wiley | volume=4 | issue=9 | date=2003-09-04 | issn=1439-4227 | doi=10.1002/cbic.200300583 | pages=821–828| pmid=12964155 | s2cid=20991778 }}</ref>

== Biosynthesis == The first step in blasticidin S biosynthesis is the combination of UDP-glucuronic acid with cytosine to form cytosylglucuronic acid (CGA). Given the product name, the enzyme that performs this combination is called CGA synthase.<ref name=Niu2015/>

Cosmid cloning experiments from the Blasticidin S producer ''Streptomyces griseochromogenes'', followed by evaluation of the putative biosynthetic gene cluster via heterologous reconstitution of Blasticidin S production in ''Streptomyces lividans'', indicated that a 20 Kbp gene cluster with 19 genes, plus possibly a peptidase outside the gene cluster that acts on the final leucylblasticidin S (LBS) intermediate, was sufficient for reconstitution of Blasticidin S biosynthesis.<ref name="Cone2003"></ref>

== Resistance genes == Resistance to blasticidin S can be conferred by either of two deaminases: BSD, originally isolated from ''Aspergillus terreus'' or bsr, isolated from ''Bacillus cereus''. Both deaminases work by modifying blasticidin S directly, replacing the amine on the cytosine ring with a hydroxyl group, resulting in the inactive deaminohydroxy-blasticin S.<ref name=TF>{{cite web|url=https://www.thermofisher.com/us/en/home/references/protocols/cloning/transformation-protocol/blasticidin-s-hcl.html |accessdate=22 April 2021 |title=Blasticidin S HCl Protocols |publisher=ThermoFisher Scientific}}</ref><ref>{{cite journal|journal=Progress in Biotechnology |volume=22 |date=2002 |pages=55–60 |title=An unexpected gift from fungicide metabolism studies: blasticidin S deaminase (BSD) from ''Aspergillus terreus'' |vauthors=Kimura M, Yamamoto M, Furuichi M, Kumasaka T, Yamaguchi I |doi=10.1016/S0921-0423(02)80043-0|isbn=9780444507396 }}</ref>

bsr and BSD are the most commonly used resistance genes. The proteins produced from these genes enable the cells carrying them to produce proteins in the presence of blasticidin.

== History == In the 1950s, a drug screening program was designed in Japan to discover a new antibiotic that prevents blast disease by the fungus ''Magnaporthe grisea''.<ref>Natural Products Isolation: Separation Methods for Antimicrobials, Antivirals, and Enzyme Inhibitors. Wagman G. H., Elsevier R. C.; p. 191 (1988).</ref>

== References == {{Reflist}}

== External links== * [https://www.uniprot.org/taxonomy/68214 Taxonomy of Streptomyces griseochromogenes]

Category:Protein synthesis inhibitor antibiotics Category:Genetic engineering Category:Pyrimidones Category:Guanidines Category:Eukaryotic selection compounds