{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 477372713 | Name = | ImageFile = Biocytin.svg | ImageSize = 200px | IUPACName = ''N''<sup>6</sup>-{5-[(3a''S'',4''S'',6a''R'')-2-Oxohexahydro-1''H''-thieno[3,4-''d'']imidazol-4-yl]pentanoyl}-<small>L</small>-lysine | SystematicName = (2''S'')-2-Amino-6-<nowiki/>{5-[(3a''S'',4''S'',6a''R'')-2-oxohexahydro-1''H''-thieno[3,4-''d'']imidazol-4-yl]pentanamido}hexanoic acid | OtherNames = Biotinyl-<small>L</small>-lysine; N<sub>ε</sub>-(+)-Biotinyl-<small>L</small>-lysine | Section1 = {{Chembox Identifiers | Abbreviations = Bct | CASNo_Ref = {{cascite|correct|CAS}} | CASNo=576-19-2 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = G6D6147J22 | ChEBI_Ref = {{ebicite|correct|EBI}} | ChEBI = 27870 | PubChem = 7098660 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 75634 | SMILES = O=C1N[C@@H]2[C@@H](SC[C@@H]2N1)CCCCC(=O)NCCCC[C@@H](C(=O)O)N | InChI = 1/C16H28N4O4S/c17-10(15(22)23)5-3-4-8-18-13(21)7-2-1-6-12-14-11(9-25-12)19-16(24)20-14/h10-12,14H,1-9,17H2,(H,18,21)(H,22,23)(H2,19,20,24)/t10-,11-,12-,14-/m0/s1 | InChIKey = BAQMYDQNMFBZNA-MNXVOIDGBH | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C16H28N4O4S/c17-10(15(22)23)5-3-4-8-18-13(21)7-2-1-6-12-14-11(9-25-12)19-16(24)20-14/h10-12,14H,1-9,17H2,(H,18,21)(H,22,23)(H2,19,20,24)/t10-,11-,12-,14-/m0/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = BAQMYDQNMFBZNA-MNXVOIDGSA-N }} | Section2 = {{Chembox Properties | C=16 | H=28 | N=4 | O=4 | S=1 | Appearance= | Density= | MeltingPt=~245 °C | BoilingPt= | Solubility= }} | Section3 = {{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt = }} | Section4 = | Section5 = | Section6 = }}

'''Biocytin''' is a chemical compound that is an amide formed from the vitamin biotin and the amino acid <small>L</small>-lysine. As an intermediate in the metabolism of biotin, biocytin occurs naturally in blood serum and urine.

The enzyme biotinidase cleaves biocytin and makes biotin available to be reused by other enzymes. Because biocytin is the natural substrate of the enzyme biotinidase, biocytin can be used to measure the biotinidase activity and therefore diagnose biotinidase deficiency.

Biocytin is also used in scientific research as a histological stain for nerve cells.<ref>{{Cite journal | doi=10.1021/cn900010d | title=Improved Neuronal Tract Tracing with Stable Biocytin-Derived Neuroimaging Agents | year=2010 | last1=Mishra | first1=Anurag | last2=Dhingra | first2=Kirti | last3=Schüz | first3=Almut | last4=Logothetis | first4=Nikos K. | author4-link = Nikos Logothetis | last5=Canals | first5=Santiago | journal=ACS Chemical Neuroscience | volume=1 | pages=129–38 | issue=2| pmc=3368650 | pmid=22778821}}</ref>

==References== {{reflist}}

Category:Carboxamides Category:Alpha-Amino acids Category:Amino acid derivatives Category:Histology