{{cs1 config|name-list-style=vanc}} {{lowercase title}} {{chembox | Verifiedfields = changed | verifiedrevid = 443420408 | Name=β-Naphthoflavone | ImageFile=beta-Naphthoflavone.svg | ImageSize= | IUPACName=Benzo[5,6]flavone | SystematicName=3-Phenyl-1''H''-naphtho[2,1-''b'']pyran-1-one | OtherNames=5,6-Benzoflavone, BNF |Section1={{Chembox Identifiers | InChI = 1/C19H12O2/c20-16-12-18(14-7-2-1-3-8-14)21-17-11-10-13-6-4-5-9-15(13)19(16)17/h1-12H | InChIKey = OUGIDAPQYNCXRA-UHFFFAOYAM | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 77013 | ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL = 26260 | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C19H12O2/c20-16-12-18(14-7-2-1-3-8-14)21-17-11-10-13-6-4-5-9-15(13)19(16)17/h1-12H | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = OUGIDAPQYNCXRA-UHFFFAOYSA-N | CASNo_Ref = {{cascite|correct|CAS}} | CASNo=6051-87-2 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 1BT0256Y8O | PubChem=2361 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank = DB06732 | SMILES = O=C\1c3c(O/C(=C/1)c2ccccc2)ccc4c3cccc4 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID=2271 }} |Section2={{Chembox Properties | C=19 | H=12 | O=2 | Appearance= | Density= | MeltingPt= | BoilingPt= | Solubility= }} |Section3={{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt = }} }}
'''β-Naphthoflavone''', also known as '''5,6-benzoflavone''', is a potent agonist of the aryl hydrocarbon receptor and as such is an inducer of such detoxification enzymes as cytochromes P450 (CYPs) and uridine 5'-diphospho-glucuronosyltransferases (UGTs).<ref>{{cite journal |vauthors=Chlouchi A, Girard C, Bonet A, Viollon-Abadie C, Heyd B, Mantion G, Martin H, Richert L |title=Effect of chrysin and natural coumarins on UGT1A1 and 1A6 activities in rat and human hepatocytes in primary culture |journal=Planta Med|volume=73 |issue=8 |pages=742–7|year=2007 |pmid=17599282 |doi=10.1055/s-2007-981548|s2cid=260281088 }}</ref> β-Naphthoflavone is a putative chemopreventive agent.<ref>{{cite journal |vauthors=Izzotti A, Bagnasco M, Cartiglia C, Longobardi M, Camoirano A, Tampa E, Lubet RA, De Flora S |title=Modulation of multigene expression and proteome profiles by chemopreventive agents |journal=Mutat Res |volume= 591|issue=1–2 |pages=212–23|year=2005 |pmid=16083920 |doi=10.1016/j.mrfmmm.2005.03.032}}</ref>
==See also== * α-Naphthoflavone
==References== <references/>
{{Aryl hydrocarbon receptor modulators}}
{{DEFAULTSORT:Naphthoflavone, beta-}} Category:Flavonoids Category:Benzochromenes
{{Ether-stub}}