{{Short description|Calcium channel blocker medication}} {{Drugbox | verifiedrevid = 459957378 | IUPAC_name = ''N''-benzyl-''N''-(3-isobutoxy-2-pyrrolidin-1-yl-propyl)aniline<!--from ChemSpider--> | image = Bepridil.svg | image_class = skin-invert-image <!--Clinical data--> | tradename = Vascor | Drugs.com = {{drugs.com|monograph|nifedipine}} | MedlinePlus = a699051 | pregnancy_US = C | pregnancy_category = | legal_status = | routes_of_administration = Oral <!--Pharmacokinetic data--> | bioavailability = Well absorbed | protein_bound = 99% | metabolism = Hepatic, CYP3A4-mediated | elimination_half-life = 42 hours | excretion = Renal <!--Identifiers--> | CAS_number_Ref = {{cascite|correct|??}} | CAS_number = 64706-54-3 | ATC_prefix = C08 | ATC_suffix = EA02 | PubChem = 2351 | IUPHAR_ligand = 2337 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank = DB01244 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 2261 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 755BO701MA | ChEBI_Ref = {{ebicite|correct|EBI}} | ChEBI = 3061 | ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL = 1008 | KEGG = D07520 <!--Chemical data--> | C=24 | H=34 | N=2 | O=1 | smiles = O(CC(C)C)CC(N1CCCC1)CN(c2ccccc2)Cc3ccccc3 | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C24H34N2O/c1-21(2)19-27-20-24(25-15-9-10-16-25)18-26(23-13-7-4-8-14-23)17-22-11-5-3-6-12-22/h3-8,11-14,21,24H,9-10,15-20H2,1-2H3 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = UIEATEWHFDRYRU-UHFFFAOYSA-N }} '''Bepridil''' (trade name '''Vascor''') is an diamine calcium channel blocker once used to treat angina pectoris. It is no longer sold in the United States.
It is nonselective.<ref name="pmid7565636">{{cite journal | vauthors = Bezprozvanny I, Tsien RW | title = Voltage-dependent blockade of diverse types of voltage-gated Ca2+ channels expressed in Xenopus oocytes by the Ca2+ channel antagonist mibefradil (Ro 40-5967) | journal = Molecular Pharmacology | volume = 48 | issue = 3 | pages = 540–549 | date = September 1995 | doi = 10.1016/S0026-895X(25)10504-X | pmid = 7565636 | url = http://molpharm.aspetjournals.org/cgi/pmidlookup?view=long&pmid=7565636 | url-access = subscription }}</ref>
It has been discussed as a possible option in the treatment of atrial fibrillation.<ref name="pmid18441448">{{cite journal | vauthors = Imai S, Saito F, Takase H, Enomoto M, Aoyama H, Yamaji S, Yokoyama K, Yagi H, Kushiro T, Hirayama A | display-authors = 6 | title = Use of bepridil in combination with Ic antiarrhythmic agent in converting persistent atrial fibrillation to sinus rhythm | journal = Circulation Journal | volume = 72 | issue = 5 | pages = 709–715 | date = May 2008 | pmid = 18441448 | doi = 10.1253/circj.72.709 | doi-access = free }}</ref>
It has been implicated in causing ventricular arrhythmia (torsades de pointes).
==Ebola research==
In June 2015 a research paper <ref>{{cite journal | vauthors = Johansen LM, DeWald LE, Shoemaker CJ, Hoffstrom BG, Lear-Rooney CM, Stossel A, Nelson E, Delos SE, Simmons JA, Grenier JM, Pierce LT, Pajouhesh H, Lehár J, Hensley LE, Glass PJ, White JM, Olinger GG | display-authors = 6 | title = A screen of approved drugs and molecular probes identifies therapeutics with anti-Ebola virus activity | journal = Science Translational Medicine | volume = 7 | issue = 290 | pages = 290ra89 | date = June 2015 | pmid = 26041706 | doi = 10.1126/scitranslmed.aaa5597 | doi-access = free }}</ref> was published finding bepridil to result in a 100% survival rate for mice exposed to ebola during an experiment searching for potential pharmaceutical ebola treatments; indicating its potential use in future ebola research and therapy.<ref>{{cite news | vauthors = Cha AE | date = 4 June 2015 | newspaper = Washington Post | url = https://www.washingtonpost.com/news/to-your-health/wp/2015/06/03/zoloft-as-ebola-cure-anti-depressant-is-one-of-a-number-of-promising-drugs-being-looked-at-by-scientists/ | title=Zoloft as Ebola cure? Antidepressant is one of a number of promising drugs being looked at by scientists.}}</ref>
==SARS-CoV-2 research==
A research paper <ref>{{cite journal | vauthors = Vatansever EC, Yang KS, Drelich AK, Kratch KC, Cho CC, Kempaiah KR, Hsu JC, Mellott DM, Xu S, Tseng CK, Liu WR | display-authors = 6 | title = Bepridil is potent against SARS-CoV-2 in vitro | journal = Proceedings of the National Academy of Sciences of the United States of America | volume = 118 | issue = 10 | article-number = e2012201118 | date = March 2021 | pmid = 33597253 | pmc = 7958448 | doi = 10.1073/pnas.2012201118 | bibcode = 2021PNAS..11812201V | doi-access = free }}</ref> showed that Bepridil inhibited cytopathogenic effects induced by SARS-CoV-2 in Vero E6 cells and in A549 cells in an in vitro assay.
== References == {{reflist}}
== External links == * {{MedlinePlusDrugInfo|medmaster|a697050}}
{{Calcium channel blockers}}
Category:Calcium channel blockers Category:1-Pyrrolidinyl compounds Category:Amines Category:Ethers
{{cardiovascular-drug-stub}}