{{Short description|Antihypertensive drug of the calcium channel blocker class}} {{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 444524924 | IUPAC_name = O5-methyl O3-[(3''R'')-1-(phenylmethyl)piperidin-3-yl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate | image = Benidipine structure.svg | image_class = skin-invert-image | alt = Skeletal formula of benidipine | width = 250px | image2 = Benidipine-3D-balls.png | image_class2 = bg-transparent | alt2 = Ball-and-stick model of the benidipine molecule
<!--Clinical data--> | tradename = | Drugs.com = {{drugs.com|international|benidipine}} | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_status = | routes_of_administration = By mouth
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
<!--Identifiers--> | PubChem = 656668 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 571013 | smiles = [O-][N+](=O)c1cccc(c1)[C@@H]4C(/C(=O)OC)=C(\N\C(=C4\C(=O)O[C@@H]3CCCN(Cc2ccccc2)C3)C)C | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C28H31N3O6/c1-18-24(27(32)36-3)26(21-11-7-12-22(15-21)31(34)35)25(19(2)29-18)28(33)37-23-13-8-14-30(17-23)16-20-9-5-4-6-10-20/h4-7,9-12,15,23,26,29H,8,13-14,16-17H2,1-3H3/t23-,26-/m1/s1 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = QZVNQOLPLYWLHQ-ZEQKJWHPSA-N | CAS_number_Ref = {{cascite|correct|??}} | CAS_number = 105979-17-7 | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 2218858 | ATC_prefix = C08 | ATC_suffix = CA15 | ATC_supplemental = | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank = | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 4G9T91JS7E
<!--Chemical data--> | C=28 | H=31 | N=3 | O=6 }}
<!-- Definition and medical uses --> '''Benidipine''' is a dihydropyridine calcium channel blocker for the treatment of high blood pressure (hypertension). It is a triple <small>L</small>-, <small>T</small>-, and <small>N</small>-type calcium channel blocker. It is reno- and cardioprotective.
<!-- Society and culture --> It was patented in 1981 and approved for medical use in 1991.<ref>{{cite book | vauthors = Fischer J, Ganellin CR |title=Analogue-based Drug Discovery |date=2006 |publisher=John Wiley & Sons |isbn=9783527607495 |page=465 |url=https://books.google.com/books?id=FjKfqkaKkAAC&pg=PA465 |language=en}}</ref>
== Dosing == Benidipine is dosed as 2–8 mg once daily.<ref>{{cite web | url = http://www.mims-online.com/Page.aspx?menuid=mng&name=Coniel%20film-coated%20tab | title = Coniel (benidipine) package insert (Philippines) | author = Hi-Eisai Pharmaceutical, Inc. | access-date = 2008-03-31 | publisher = CMPMedica | work = MIMS Philippines | archive-date = 2019-12-14 | archive-url = https://web.archive.org/web/20191214143821/http://www.mims-online.com/Page.aspx?menuid=mng&name=Coniel%20film-coated%20tab | url-status = dead }}</ref>
==Mechanism== Benidipine is a calcium channel blocker.
Benidipine has additionally been found to act as an antagonist of the mineralocorticoid receptor, or as an antimineralocorticoid.<ref name="Luther2014">{{cite journal | vauthors = Luther JM | title = Is there a new dawn for selective mineralocorticoid receptor antagonism? | journal = Current Opinion in Nephrology and Hypertension | volume = 23 | issue = 5 | pages = 456–61 | date = September 2014 | pmid = 24992570 | pmc = 4248353 | doi = 10.1097/MNH.0000000000000051 }}</ref>
==Names== Other names include Benidipinum or benidipine hydrochloride.
Benidipine is sold as Coniel by Kyowa Hakko Kogyo.
Benidipine is initially licensed for use in Japan and selected Southeast Asian countries and later in Turkey, where it is sold as 4 mg tablets.
== References == {{Reflist}}
{{Channelergics}} {{Mineralocorticoidics}}
Category:Antimineralocorticoids Category:Calcium channel blockers Category:Carboxylate esters Category:Dihydropyridines Category:Methyl esters Category:3-Nitrophenyl compounds Category:Piperidines