{{Chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 459526464 | ImageFile = Beauvericin.svg | ImageClass = skin-invert-image | ImageSize = 200px | ImageFile2 = Beauvericin_3d_structure.png | ImageClass2 = bg-transparent | ImageSize2 = 200px | IUPACName = (3''S'',6''R'',9''S'',12''R'',15''S'',18''R'')-3,9,15-Tribenzyl-6,12,18-triisopropyl-4,10,16-trimethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone | OtherNames = |Section1={{Chembox Identifiers | InChIKey = GYSCAQFHASJXRS-FFCOJMSVBB | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C45H57N3O9/c1-28(2)37-40(49)46(7)35(26-32-21-15-11-16-22-32)44(53)56-39(30(5)6)42(51)48(9)36(27-33-23-17-12-18-24-33)45(54)57-38(29(3)4)41(50)47(8)34(43(52)55-37)25-31-19-13-10-14-20-31/h10-24,28-30,34-39H,25-27H2,1-9H3/t34-,35-,36-,37+,38+,39+/m0/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = GYSCAQFHASJXRS-FFCOJMSVSA-N | CASNo_Ref = {{cascite|correct|CAS}} | CASNo = 26048-05-5 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 26S048LS2R | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 373872 | PubChem = 3007984 | ChEBI_Ref = {{ebicite|correct|EBI}} | ChEBI = 3000 | KEGG_Ref = {{keggcite|changed|kegg}} | KEGG = C11590 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 2277520 | SMILES = O=C1N(C)[C@H](C(=O)O[C@@H](C(=O)N([C@H](C(=O)O[C@@H](C(=O)N([C@H](C(=O)O[C@@H]1C(C)C)Cc2ccccc2)C)C(C)C)Cc3ccccc3)C)C(C)C)Cc4ccccc4 | InChI = 1/C45H57N3O9/c1-28(2)37-40(49)46(7)35(26-32-21-15-11-16-22-32)44(53)56-39(30(5)6)42(51)48(9)36(27-33-23-17-12-18-24-33)45(54)57-38(29(3)4)41(50)47(8)34(43(52)55-37)25-31-19-13-10-14-20-31/h10-24,28-30,34-39H,25-27H2,1-9H3/t34-,35-,36-,37+,38+,39+/m0/s1 }} |Section2={{Chembox Properties | C=45|H=57|N=3|O=9 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}
'''Beauvericin''' is a depsipeptide with antibiotic and insecticidal effects belonging to the enniatin family. It was isolated from the fungus ''Beauveria bassiana'', but is also produced by several other fungi, including several ''Fusarium'' species;<ref>{{cite journal | vauthors = Hamill RL, Higgens CE, Boaz HE, Gorman M | year = 1969 | title = The structure of beauvericin, a new depsipeptide antibiotic toxic to Artemia salina | journal = Tetrahedron Letters | volume = 10 | issue = 49| pages = 4255–4258 | doi = 10.1016/S0040-4039(01)88668-8 }}</ref><ref name="PMID 9687479">{{cite journal |author=Logrieco A |title=Beauvericin Production by Fusarium Species |journal=Appl Environ Microbiol |volume=64 |issue=8 |pages=3084–8 |year=1998 |pmid=9687479 |doi= 10.1128/AEM.64.8.3084-3088.1998|pmc=106821 |name-list-style=vanc|author2=Moretti A |author3=Castella G |display-authors=3 |last4=Kostecki |first4=M |last5=Golinski |first5=P |last6=Ritieni |first6=A |last7=Chelkowski |first7=J|bibcode=1998ApEnM..64.3084L }}</ref> it may therefore occur in grain (such as corn, wheat and barley) contaminated with these fungi.<ref name="PMID 9687479"/><ref>{{cite journal |vauthors=Logrieco A, Rizzo A, Ferracane R, Ritieni A |title=Occurrence of Beauvericin and Enniatins in Wheat Affected by Fusarium avenaceum Head Blight |journal=Appl Environ Microbiol |volume=68 |issue=1 |pages=82–5 |year=2002 |pmid=11772612 |doi=10.1128/AEM.68.1.82-85.2002 |pmc=126553|bibcode=2002ApEnM..68...82L }}</ref><ref>{{cite journal |vauthors=Jestoi M, Rokka M, Yli-Mattila T, Parikka P, Rizzo A, Peltonen K |title=Presence and concentrations of the Fusarium-related mycotoxins beauvericin, enniatins and moniliformin in finnish grain samples |journal=Food Additives and Contaminants |volume=21 |issue=8 |pages=794–802 |year=2004 |pmid=15370831 |doi=10.1080/02652030410001713906|s2cid=19565366 }}</ref> Beauvericin is active against Gram-positive bacteria and mycobacteria, and is also capable of inducing programmed cell death in mammals.<ref name="PMID 9687479"/>
Chemically, beauvericin is a cyclic hexadepsipeptide with alternating N-methyl-phenylalanyl and D-hydroxy-iso-valeryl residues. Its ion-complexing capability allows beauvericin to transport alkaline earth metal and alkali metal ions across cell membranes.{{cn|date=February 2023}}
Beauvericin has ''in vitro'' fungicidal effects on ''Candida parapsilosis'' when used in combination with the antifungal drug ketoconazole at dosages of 0.1 μg/ml. Increased survivability rates and low cytotoxicity were also observed in mouse models.<ref>{{cite journal |author1=Zhang L |author2=Yan K |author3=Zhang Y |author4=Huang R |author5=Bian J |author6=Zheng C |author7=Sun H |author8=Chen Z |author9=Sun N |author10=An R |author11=Min F |author12=Zhao W |author13=Zhuo Y |author14=You J |author15=Song Y |author16=Yu Z |author17=Liu Z |author18=Yang K |author19=Gao H |author20=Dai H |author21=Zhang X |author22=Wang J |author23=Fu C |author24=Pei G |author25=Liu J |author26=Zhang S |author27=Goodfellow M |author28=Jiang Y |author29=Kuai J |author30=Zhou G |author31=Chen X.K |title=High-throughput synergy screening identifies microbial metabolites as combination agents for the treatment of fungal infections |journal=Proc Natl Acad Sci U S A |volume=104 |issue=11 |pages=4606–11 |year=2007 |pmid=17360571 |doi=10.1073/pnas.0609370104 |pmc=1838648|bibcode=2007PNAS..104.4606Z |doi-access=free }}</ref>
== References == {{Reflist}}
Category:Antibiotics Category:Mycotoxins Category:Ionophores Category:Depsipeptides