{{Short description|Chemical compound}} {{Drugbox | Verifiedfields = changed | verifiedrevid = 459590863 | IUPAC_name = 8-(piperazin-1-yl)-2''H''-chromen-2-one | image = Batoprazine-ifa.png | image_class = skin-invert-image | width = 200px
<!--Clinical data--> | tradename = | legal_status = Uncontrolled | routes_of_administration = Oral
<!--Identifiers--> | CAS_number_Ref = {{cascite|changed|??}} | CAS_number = 105685-11-8 | ATC_prefix = none | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C13H14N2O2/c16-12-5-4-10-2-1-3-11(13(10)17-12)15-8-6-14-7-9-15/h1-5,14H,6-9H2 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = MTYYDFXUUJQQRS-UHFFFAOYSA-N | PubChem = 184839 | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 2104650 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 160706 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = EZY3PL8Q0M | synonyms = 8-(1-piperazinyl)coumarin;<br />8-(1-piperazinyl)-2''H''-
<!--Chemical data--> | C=13 | H=14 | N=2 | O=2 | smiles = O=C/2Oc1c(cccc1\C=C\2)N3CCNCC3 }}
'''Batoprazine''' is a drug of the phenylpiperazine class which has been described as a serenic or antiaggressive agent.<ref name="pmid15817750">{{cite journal | author = Olivier B | title = Serotonin and aggression | journal = Annals of the New York Academy of Sciences | volume = 1036 | pages = 382–92 |date=December 2004 | pmid = 15817750 | doi = 10.1196/annals.1330.022 | s2cid = 45595253 }}</ref><ref name="pmid16310769">{{cite journal |vauthors=Olivier B, van Oorschot R | title = 5-HT1B receptors and aggression: a review | journal = European Journal of Pharmacology | volume = 526 | issue = 1–3 | pages = 207–17 |date=December 2005 | pmid = 16310769 | doi = 10.1016/j.ejphar.2005.09.066 }}</ref> It acts as a 5-HT<sub>1A</sub> and 5-HT<sub>1B</sub> receptor agonist.<ref name="pmid16310769"/><ref name="pmid9200664">{{cite journal |vauthors=Gommans J, Hijzen TH, Maes RA, Olivier B | title = Discriminative stimulus properties of eltoprazine | journal = Life Sciences | volume = 61 | issue = 1 | pages = 11–9 | year = 1997 | pmid = 9200664 | doi = 10.1016/S0024-3205(97)00352-4}}</ref> It is closely related to eltoprazine, fluprazine, and naphthylpiperazine, of which possess similar actions and effects.<ref name="pmid9200664"/>
== See also == * List of investigational aggression drugs
== References == {{Reflist}}
{{Serenics}} {{Serotonergics}} {{Piperazines}}
Category:Antiaggressive drugs Category:1-Piperazinyl compounds Category:Coumarin drugs Category:Serotonin receptor agonists