{{redirect|Canary yellow|the color|Yellow|the bird|Yellow canary}} {{chembox | Watchedfields = changed | verifiedrevid = 401809121 | Name = Auramine O | ImageFile = Auramine O Formula V.1.svg | ImageName = 340 | ImageFileL1 = Sample of Auramine O.jpg | ImageSizeL1 = 130 | ImageCaptionL1 = Solid Auramine O | ImageFileR1 = Auramine O in aqueous solution.jpg | ImageSizeR1 = 130 | ImageCaptionR1 = Auramine O in aqueous solution | IUPACName = bis[4-(dimethylamino)phenyl]methaniminium chloride | OtherNames = auramine hydrochloride, basic yellow 2, pyocatanium aureum, aizen auramine, pyoktanin yellow, canary yellow, pyoktanin, or C.I. 41000 |Section1={{Chembox Identifiers | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 16254 | InChI = 1/C17H21N3/c1-19(2)15-9-5-13(6-10-15)17(18)14-7-11-16(12-8-14)20(3)4/h5-12,18H,1-4H3 | InChIKey = JPIYZTWMUGTEHX-UHFFFAOYAY | PubChem = 17170 | EC_number = 219-567-2 | UNII = DL992L7W39 | InChI1 = 1/C17H21N3.ClH/c1-19(2)15-9-5-13(6-10-15)17(18)14-7-11-16(12-8-14)20(3)4;/h5-12,18H,1-4H3;1H | InChIKey1 = KSCQDDRPFHTIRL-UHFFFAOYAK | SMILES1 = Cl.[N@H]=C(c1ccc(N(C)C)cc1)c2ccc(N(C)C)cc2 | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C17H21N3.ClH/c1-19(2)15-9-5-13(6-10-15)17(18)14-7-11-16(12-8-14)20(3)4;/h5-12,18H,1-4H3;1H | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = KSCQDDRPFHTIRL-UHFFFAOYSA-N | CASNo_Ref = {{cascite|correct|CAS}} | CASNo = 2465-27-2 | SMILES = [N@H]=C(c1ccc(N(C)C)cc1)c2ccc(N(C)C)cc2 }} |Section2={{Chembox Properties | C=17 | H=22 | N=3 | Cl=1 | Density = | MeltingPtC = 267 | MeltingPt_notes = | BoilingPt = }} |Section7={{Chembox Hazards | GHSPictograms = {{GHS06}}{{GHS07}}{{GHS08}}{{GHS09}} | GHSSignalWord = Danger | HPhrases = {{H-phrases|302|311|319|351|411}} | PPhrases = {{P-phrases|201|202|264|270|273|280|281|301+312|302+352|305+351+338|308+313|312|322|330|337+313|361|363|391|405|501}} | NFPA-H = 3 | NFPA-F = 1 | NFPA-R = 0 }} }}

'''Auramine O''' is a diarylmethane dye used as a fluorescent stain. In its pure form, Auramine O appears as yellow needle crystals. It is insoluble in water and soluble in ethanol and DMSO.

Auramine O can be used to stain acid-fast bacteria (e.g. ''Mycobacterium'', where it binds to the mycolic acid in its cell wall) in a way similar to Ziehl–Neelsen stain.<ref name=Kommareddi_1984>{{cite journal |vauthors=Kommareddi S, Abramowsky C, Swinehart G, Hrabak L |title=Nontuberculous mycobacterial infections: comparison of the fluorescent auramine-O and Ziehl–Neelsen techniques in tissue diagnosis |journal=Hum Pathol |volume=15 |issue=11 |pages=1085–9 |year=1984 |pmid=6208117 |doi=10.1016/S0046-8177(84)80253-1}}</ref> It can also be used as a fluorescent version of the Schiff reagent.<ref name=Khavkin_1980>{{cite journal |vauthors=Khavkin T, Kudryavtseva M, Dragunskaya E, Polotsky Y, Kudryavtsev B |display-authors=3|title=Fluorescent PAS-reaction study of the epithelium of normal rabbit ileum and after challenge with enterotoxigenic Escherichia coli |journal=Gastroenterology |volume=78 |issue=4 |pages=782–90 |year=1980 |pmid=6986320|doi=10.1016/0016-5085(80)90684-8 |doi-access=free }}</ref>

Auramine O can be used together with Rhodamine B as the Truant auramine-rhodamine stain for ''Mycobacterium tuberculosis''.<ref name=Truant_1962>{{cite journal |vauthors=Truant J, Brett W, Thomas W |title=Fluorescence microscopy of tubercle bacilli stained with auramine and rhodamine |journal=Henry Ford Hosp Med Bull |volume=10 |pages=287–96 |year=1962 |pmid=13922644}}</ref><ref name=Arrowood_1989>{{cite journal |vauthors=Arrowood M, Sterling C |title=Comparison of conventional staining methods and monoclonal antibody-based methods for Cryptosporidium oocyst detection |journal=J Clin Microbiol |volume=27 |issue=7 |pages=1490–5 |year=1989 |pmid=2475523 |pmc=267601|doi=10.1128/JCM.27.7.1490-1495.1989 }}</ref> It can be also used as an antiseptic agent.

==References== {{Reflist}}

==External links== * [http://omlc.ogi.edu/spectra/PhotochemCAD/html/auramineO.html Auramine O spectra data]

{{Stains}}

Category:Diarylmethane dyes Category:Staining dyes Category:Antiseptics Category:Hydrochlorides