{{Short description|Chemical compound}} {{Chembox <!-- Images --> | ImageFile = Argopsin.svg | ImageSize = 200px <!-- Names --> | IUPACName = 2,8-Dichloro-9-hydroxy-3-methoxy-1,4,7-trimethyl-6-oxobenzo[''b''][1,4]benzodioxepine-10-carbaldehyde | OtherNames = 1-Chloropannarin <!-- Sections --> | Section1 = {{Chembox Identifiers | CASNo = 52809-10-6 | CASNo_Ref = {{Cascite|changed|EPA}} | ChEBI = 144113 | ChEMBL = 1982613 | ChemSpiderID = 142840 | PubChem = 162698 | InChI = 1S/C18H14Cl2O6/c1-6-10-17(9(5-21)13(22)11(6)19)25-15-7(2)12(20)14(24-4)8(3)16(15)26-18(10)23/h5,22H,1-4H3 | InChIKey = SNNDIPJEAQAKTJ-UHFFFAOYSA-N | SMILES = CC1=C2C(=C(C(=C1Cl)O)C=O)OC3=C(C(=C(C(=C3OC2=O)C)OC)Cl)C }} | Section2 = {{Chembox Properties | C=18 | H=14 | Cl=2 | O=6 | Appearance = | Density = | MeltingPtC = | Solubility = }} | Section3 = {{Chembox Hazards }} }}
'''Argopsin''', also known as '''1-chloropannarin''', is a secondary metabolite produced by many lichen species, such as ''Biatora cuprea''<ref>Hörður Kristinsson (2016). ''Íslenskar fléttur''. Reykjavík: Hið íslenska bókmenntafélag. ISBN 978-9979-66-347-8</ref> and ''Micarea lignaria''.<ref>Flóra Íslands. [http://www.floraislands.is/FLETTUR/micarlig.html Viðarkúpa - ''Micarea lignaria'']. Sótt 4. mars 2017.</ref>
Argopsin (also known as 1'-chloropannarin) is a chlorinated depsidone compound first isolated from the lichen ''Argopsis friesiana'' by Siegfried Huneck and Elke Mackenzie in 1975. It was independently discovered by both Huneck and Mackenzie's team and by Bodo and Molho in the same year. The structure was confirmed through multiple analytical methods including mass spectrometry, which showed characteristic isotope peaks at mass-to-charge ratios (m/z) of 396, 398, and 400 in a 9:6:1 ratio, indicating the presence of two chlorine atoms. Its UV spectrum matched that of pannarin, and infrared spectroscopy revealed characteristic aldehyde (1725 cm⁻¹) and hydroxyl (3500 cm⁻¹) bands. The researchers synthesized argopsin by chlorinating pannarin in acetic acid, which produced a compound identical to the naturally occurring substance. This synthesis also helped confirm a recently revised chemical structure of pannarin, correcting an earlier proposed structure from 1941.<ref name="Huneck & Lamb 1975"/>
In the lichen ''A. friesiana'', argopsin occurs alongside atranorin, though its presence is described as "inconstant". The related species ''A. megalospora'' does not contain argopsin but instead contains various combinations of other lichen substances including atranorin, fumarprotocetraric acid, psoromic acid, and perlatolic acid.<ref name="Huneck & Lamb 1975"/> The compound produces a red color when treated with ferric chloride in ethanol and an orange color with ''p''-phenylenediamine in ethanol, characteristics useful for its identification.<ref name="Huneck & Lamb 1975">{{cite journal |doi=10.1016/0031-9422(75)85363-5 |title = 1'-Chloropannarin, a new depsidone from ''Argopsis friesiana'': Notes on the structure of pannarin and on the chemistry of the lichen genus ''Argopsis'' |year=1975 |last1=Huneck |first1=Siegfried |last2=Lamb |first2 = I. Mackenzie |journal = Phytochemistry |volume=14 |issue=7 |pages=1625–1628}}</ref>
== Uses == Argopsin can have photohemolytic effect when activated under ultraviolet light with a wavelength of 366 nm.<ref>{{cite journal | pmid = 8289110| year = 1993| last1 = Hidalgo| first1 = M. E.| last2 = Fernández| first2 = E.| last3 = Quilhot| first3 = W.| last4 = Lissi| first4 = E. A.| title = Photohemolytic activity of lichen metabolites| journal = Journal of Photochemistry and Photobiology B: Biology| volume = 21| issue = 1| pages = 37–40| doi = 10.1016/1011-1344(93)80161-2| bibcode = 1993JPPB...21...37H}}</ref>
Argopsin has been shown to have an ''in vitro'' effect on ''Leishmania'' at a concentration of 50 μg/ml.<ref>{{cite journal | doi = 10.1016/S0742-8413(96)00127-2 | title = Activity of compounds isolated from chilean lichens against experimental cutaneous leishmaniasis | year = 1997 | last1 = Fournet | first1 = Alain | last2 = Ferreira | first2 = Maria-Elena | last3 = De Arias | first3 = Antonieta Rojas | last4 = De Ortiz | first4 = Susana Torres | last5 = Inchausti | first5 = Alba | last6 = Yalaff | first6 = Gloria | last7 = Quilhot | first7 = Wanda | last8 = Fernandez | first8 = Ernesto | last9 = Hidalgo | first9 = Maria Elena | journal = Comparative Biochemistry and Physiology Part C: Pharmacology, Toxicology and Endocrinology | volume = 116 | issue = 1 | pages = 51–54 | pmid = 9080673 }}</ref>
== References == {{Reflist}}
Category:Secondary metabolites Category:Lichen products Category:Chloroarenes Category:Heterocyclic compounds with 3 rings Category:Lactones Category:Cyclic ethers Category:Methoxy compounds Category:Benzodioxepines Category:Chlorine-containing natural products