{{chembox | verifiedrevid = 459709967 | ImageFile=Apterin.png | ImageFile2=Apterin 3D sticks.png | IUPACName=(8''S'',9''R'')-8-[2-(β-<small>D</small>-Glucopyranosyloxy)propan-2-yl]-9-hydroxy-8,9-dihydro-2''H''-furo[2,3-''h''][1]benzopyran-2-one | SystematicName=(8''S'',9''R'')-9-Hydroxy-8-(2-<nowiki/>{[(2''S'',3''R'',4''S'',5''S'',6''R'')-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}propan-2-yl)-8,9-dihydro-2''H''-furo[2,3-''h''][1]benzopyran-2-one | OtherNames= |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|??}} | CASNo=53947-89-0 | PubChem=15945058 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 26286869 | SMILES = CC(C)([C@@H]1[C@@H](c2c(ccc3c2oc(=O)cc3)O1)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O | InChI = 1/C20H24O10/c1-20(2,30-19-16(26)15(25)13(23)10(7-21)28-19)18-14(24)12-9(27-18)5-3-8-4-6-11(22)29-17(8)12/h3-6,10,13-16,18-19,21,23-26H,7H2,1-2H3/t10-,13-,14-,15+,16-,18+,19+/m1/s1 | InChIKey = ALEQYOXVXJKFOM-KTZZUYPUBG | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C20H24O10/c1-20(2,30-19-16(26)15(25)13(23)10(7-21)28-19)18-14(24)12-9(27-18)5-3-8-4-6-11(22)29-17(8)12/h3-6,10,13-16,18-19,21,23-26H,7H2,1-2H3/t10-,13-,14-,15+,16-,18+,19+/m1/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = ALEQYOXVXJKFOM-KTZZUYPUSA-N }} |Section2={{Chembox Properties | C=20 | H=24 | O=10 | Appearance= | Density= | MeltingPt= | BoilingPt= | Solubility= }} |Section3={{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt = }} }}
'''Apterin''' is a furanocoumarin and the glucoside of vaginol.<!-- this is not vandalism; it's a real compound --> It has been isolated from the root of plants in the family Apiaceae such as members of the genus ''Angelica'', including the garden angelica and ''Zizia aptera''.<ref>{{cite journal |author1=Lemmich, John |author2=Havelund, Svend |author3=Thastrup, Ole | journal = Phytochemistry | year = 1983 | volume = 22 | issue = 2 | pages = 553–5 | doi = 10.1016/0031-9422(83)83044-1 | title = Dihydrofurocoumarin glucosides from Angelica archangelica and Angelica silvestris}}</ref><ref>{{cite journal | doi = 10.1016/0031-9422(74)85117-4| title = Apterin, an unusual glucoside of Zizia aptera| journal = Phytochemistry| volume = 13| issue = 9| pages = 1925–1927| year = 1974| last1 = Steck| first1 = Warren| last2 = Wetter| first2 = L.R.}}</ref>
== References == {{reflist}}
{{coumarin}}
Category:Coumarin glycosides Category:Furanocoumarins Category:Glucosides
{{aromatic-stub}}