{{Short description|Chemical compound}} {{Drugbox | verifiedrevid = 451558531 | IUPAC_name = ''N''-[2-(3-Formyl-2,5-dimethylpyrrol-1-yl)ethyl]acetamide | image = Aloracetam.svg | image_class = skin-invert-image | width = 220
<!--Clinical data--> | tradename = | pregnancy_category = | legal_US = unscheduled | legal_US_comment = Not FDA approved | routes_of_administration =
<!--Pharmacokinetic data--> | bioavailability = | metabolism = | excretion =
<!--Identifiers--> | CAS_number_Ref = {{cascite|correct|??}} | CAS_number = 119610-26-3 | ATC_prefix = none | PubChem = 178134 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 155069 | ChEMBL = 2104637 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = U0RKZ75D0T
<!--Chemical data--> | C=11 | H=16 | N=2 | O=2 | smiles = CC1=CC(=C(N1CCNC(=O)C)C)C=O | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C11H16N2O2/c1-8-6-11(7-14)9(2)13(8)5-4-12-10(3)15/h6-7H,4-5H2,1-3H3,(H,12,15) | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = ZUQSGZULKDDMEW-UHFFFAOYSA-N }}
'''Aloracetam''' (INN) is a drug described as a nootropic which is closely related to, but technically not of (as it lacks a pyrrolidone ring), the racetam family of compounds.<ref name="WHO2011">{{cite web | title = The Use of Stems in the Selection of International Nonproprietary Names (INN) for Pharmaceutical Substances | year = 2011 | publisher = World Health Organization | url =https://www.who.int/medicines/services/inn/StemBook_2011_Final.pdf | accessdate = 22 May 2015}}</ref><ref name="George1998">{{cite book| vauthors = George CF |title=Drug Therapy in Old Age|url=https://books.google.com/books?id=pTVsAAAAMAAJ|date=7 July 1998|publisher=Wiley|isbn=978-0-471-94149-1}}</ref><ref name="GanellinTriggle1996">{{cite book| vauthors = Ganellin CR, Triggle DJ |title=Dictionary of Pharmacological Agents|url=https://books.google.com/books?id=Z_mfTTIApVEC&pg=PA615|date=21 November 1996|publisher=CRC Press|isbn=978-0-412-46630-4|pages=615–}}</ref> It was studied by Aventis for the treatment of Alzheimer's disease,<ref name="pmid16908974">{{cite journal | vauthors = Fischer F, Matthisson M, Herrling P | title = List of drugs in development for neurodegenerative diseases | journal = Neuro-Degenerative Diseases | volume = 1 | issue = 1 | pages = 50–70 | date = 2004 | pmid = 16908974 | doi = 10.1159/000077879 | doi-access = free }}</ref> but was never marketed.
==See also== * Piracetam
==References== {{Reflist}}
{{Racetams}}
Category:Racetams Category:Pyrroles Category:Acetamides Category:Nootropics Category:Abandoned drugs
{{nervous-system-drug-stub}}