{{chembox | Verifiedfields = changed | verifiedrevid = 477317756 | Name = Alliin | ImageFile = L-alliin-2D-skeletal.png | ImageName = Alliin skeletal view | ImageFile1 = L-alliin-3D-balls.png | ImageName1 = Alliin ball view | SystematicName = (2''R'')-2-Amino-3-[(''S'')-(prop-2-ene-1-sulfinyl)]propanoic acid | OtherNames = 3-(2-Propenylsulfinyl)alanine<br />(''S'')-3-(2-Propenylsulfinyl)-{{small|L}}-alanine<br />3-[(''S'')-Allylsulfinyl]-{{small|L}}-alanine<br />''S''-Allyl-{{small|L}}-cysteine sulfoxide |Section1={{Chembox Identifiers | SMILES = C=CCS(=O)CC(C(=O)O)N | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 7850537 | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 2596 | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 464166 | PubChem = 9576089 | EC_number = 209-118-9 | UNII = 7I4L2D0E9G | KEGG = C08265 <!--| Reaxys = 6767615 --> | SMILES1 = N[C@H](C(=O)O)C[S@@](=O)CC=C | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C6H11NO3S/c1-2-3-11(10)4-5(7)6(8)9/h2,5H,1,3-4,7H2,(H,8,9)/t5-,11-/m0/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = XUHLIQGRKRUKPH-DYEAUMGKSA-N | CASNo_Ref = {{cascite|changed|??}} | CASNo = 556-27-4 }} |Section2={{Chembox Properties | C=6 | H=11 | N=1 | O=3 | S=1 | Appearance = White to off white crystalline powder | Solubility = Soluble | MeltingPt = {{convert|163|-|165|C|F}} }} |Section7={{Chembox Hazards | ExternalSDS = [http://www.mpbio.com/includes/msds/ansi/en/194125-en-ansi.pdf External MSDS] | NFPA-H = 1 | NFPA-F = 1 | NFPA-R = 0 | GHSPictograms = {{GHS07}} | GHSSignalWord = Warning | HPhrases = {{H-phrases|315|319|335}} | PPhrases = {{P-phrases|261|264|271|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|403+233|405|501}} }} }}

'''Alliin''' {{IPAc-en|ˈ|æ|l|i|.|ɪ|n}} is a sulfoxide that is a natural constituent of fresh garlic.<ref>{{cite journal | author = Iberl, B | title = Quantitative Determination of Allicin and Alliin from Garlic by HPLC | journal = Planta Med. | volume = 56 | issue =3 | pages = 320–326 | year = 1990 | doi = 10.1055/s-2006-960969 | pmid = 17221429 | last2 = Winkler, G | last3 = Müller, B | last4 = Knobloch, K | bibcode = 1990PlMed..56..320I | s2cid = 30268881 }}</ref> It is a derivative of the amino acid cysteine. When fresh garlic is chopped or crushed, the enzyme alliinase converts alliin into allicin, which is responsible for the aroma of fresh garlic. Allicin and other thiosulfinates in garlic are unstable and form a number of other compounds, such as diallyl sulfide (DAS), diallyl disulfide (DADS) and diallyl trisulfide (DAT), dithiins and ajoene.<ref name="Amagase ">{{cite journal | last1=Amagase | first1=Harunobu | last2=Petesch | first2=Brenda L. | last3=Matsuura | first3=Hiromichi | last4=Kasuga | first4=Shigeo | last5=Itakura | first5=Yoichi | title=Intake of Garlic and Its Bioactive Components | journal=The Journal of Nutrition | volume=131 | issue=3 | year=2001 | issn=0022-3166 | doi=10.1093/jn/131.3.955s | pages=955S–962S| pmid=11238796 | doi-access=free }}</ref> Garlic powder is not a source of alliin, nor is fresh garlic upon maceration, since the enzymatic conversion to allicin takes place in the order of seconds.

Alliin was the first natural product found to have both carbon- and sulfur-centered stereochemistry.<ref>{{cite book |title= Garlic and Other Alliums: The lore and the science |author = Block, E |publisher= Royal Society of Chemistry |year= 2009 |pages= 100–106 }}</ref>

== Chemical synthesis == The first reported synthesis, by Stoll and Seebeck in 1951,<ref>{{cite book |author1 = Stoll, A|author2 = Seeback, E |title = Advances in Enzymology and Related Areas of Molecular Biology |chapter = Chemical Investigations on Alliin, the Specific Principle of Garlic |date = 1951 |volume=11 |pages=377–400|doi = 10.1002/9780470122563.ch8|pmid = 24540596|isbn = 9780470122563}}</ref> begins the alkylation of {{small|L}}-cysteine with allyl bromide to form deoxyalliin. Oxidation of this sulfide with hydrogen peroxide gives both diastereomers of {{small|L}}-alliin, differing in the orientation of the oxygen atom on the sulfur stereocenter.

:left|frameless|420 px{{clear-left}}

A newer route, reported by Koch and Keusgen in 1998,<ref>{{cite journal|title = Diastereoselective synthesis of alliin by an asymmetric sulfur oxidation|author1= Koch |author2=Keusgen|date = 1998|journal = Pharmazie |volume=53 |issue=668–671 }}</ref> allows stereospecific oxidation using conditions similar to the Sharpless asymmetric epoxidation. The chiral catalyst is produced from diethyl tartrate and titanium isopropoxide.

== Medical exploration == {{medref|section|date=July 2024}} Garlic has been used since antiquity for conditions now associated with oxidative stress (production and accumulation of reactive oxygen species (ROS)).{{cn|date=July 2024}} In an ''in vitro'' test, garlic powder showed antioxidant properties, and alliin showed good hydroxyl radical-scavenging effect.<ref>{{cite journal |author1=Kourounakis, PN |author2=Rekka, EA | title = Effect on active oxygen species of alliin and ''Allium sativum'' (garlic) powder | journal = Res. Commun. Chem. Pathol. Pharmacol. | volume = 74 | issue = 2 | pages = 249–252 | date=November 1991 | pmid = 1667340 }}</ref> Alliin has also been found to affect immune responses in blood cells ''in vitro''.<ref>{{cite journal | author = Salman, H | title = Effect of a garlic derivative (alliin) on peripheral blood cell immune responses | journal = Int. J. Immunopharmacol. | volume = 21 | issue = 9 | pages = 589–597 | date=September 1999 | pmid = 10501628 | doi = 10.1016/S0192-0561(99)00038-7 | last2 = Bergman | first2 = M | last3 = Bessler | first3 = H | last4 = Punsky | first4 = I | last5 = Djaldetti | first5 = M }}</ref>

==References== {{reflist}}

Category:Alpha-Amino acids Category:Sulfoxides Category:Sulfur amino acids Category:Nutrition Category:Allyl compounds