{{Chembox | ImageFile = Acedianthrone.svg | ImageSize = | ImageAlt = | PIN = Aceanthryleno[2,1-''a'']aceanthrylene-4,12-dione | OtherNames = |Section1={{Chembox Identifiers | CASNo = 129-68-0 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = ZTD26V6AAY | PubChem = 67214 | ChemSpiderID = 60550 | EC_number = 204-960-3 | DTXSID = DTXSID6059605 | StdInChI=1S/C30H14O2/c31-29-17-9-3-1-7-15(17)25-23-19(11-5-13-21(23)29)28-26-16-8-2-4-10-18(16)30(32)22-14-6-12-20(24(22)26)27(25)28/h1-14H | StdInChIKey = NUNPDAMQSBMCIG-UHFFFAOYSA-N | SMILES = C1=CC=C2C(=C1)C3=C4C5=C6C(=CC=C5)C(=O)C7=CC=CC=C7C6=C4C8=C3C(=CC=C8)C2=O }} |Section2={{Chembox Properties | C=30|H=14|O=2 | Appearance = | Density = 1.484 g/cm<sup>3</sup><ref>{{cite journal|doi=10.1107/S0365110X54000266|title=Observed and calculated bond lengths in acedianthrone|journal=Acta Crystallographica|volume=7|pages=127–128|year=1954|last1=Friedlander|first1=P. H.|last2=Goodwin|first2=T. H.|last3=Robertson|first3=J. M.|doi-access=free}}</ref> | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}

'''Acedianthrone''' is an octacyclic relative of anthraquinone that is used as a pigment. It is produced from anthrone by condensation with glyoxal followed by dehydrogenation.<ref name=UllmannDye>{{ Ullmann | last1= Bien|first1=H.-S.| last2=Stawitz |first2=J.| last3= Wunderlich|first3=K. | title = Anthraquinone Dyes and Intermediates | doi = 10.1002/14356007.a02_355|year=2005 }}</ref>

==References== <references />

Category:Anthraquinones