{{chembox | ImageFile = Acecarbromal.svg | ImageClass = skin-invert-image | ImageFile_Ref = {{chemboximage|correct|??}} | ImageName = Seletal formula of acebromal | PIN = ''N''-(Acetylcarbamoyl)-2-bromo-2-ethylbutanamide | OtherNames = 1-Acetyl-3-(2-bromo-2-ethylbutyryl)urea |Section1={{Chembox Identifiers | CASNo = 77-66-7 | CASNo_Ref = {{cascite|correct|??}} | PubChem = 6489 | ChEMBL = 2104673 | ChemSpiderID = 6244 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | UNII = E47C56IGOY | UNII_Ref = {{fdacite|correct|FDA}} | EINECS = 201-047-1 | KEGG = D07059 | KEGG_Ref = {{keggcite|correct|kegg}} | MeSHName = acecarbromal | SMILES = CCC(Br)(CC)C(=O)NC(=O)NC(C)=O | StdInChI = 1S/C9H15BrN2O3/c1-4-9(10,5-2)7(14)12-8(15)11-6(3)13/h4-5H2,1-3H3,(H2,11,12,13,14,15) | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = SAZUGELZHZOXHB-UHFFFAOYSA-N | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} }} |Section2={{Chembox Properties | C=9 | H=15 | Br=1 | N=2 | O=3 }} |Section3={{Chembox Pharmacology | AdminRoutes = Oral | Legal_status = Rx only }} |Section4={{Chembox Related | OtherCompounds = {{unbulleted list|Buformin|Methylarginine|Asymmetric dimethylarginine|''N''-Propyl-<small>L</small>-arginine}} }} }}
'''Acecarbromal''' (INN) (brand names '''Sedamyl''', '''Abasin''', '''Carbased''', '''Paxarel''', '''Sedacetyl''', numerous others), also known as '''acetylcarbromal''' and '''acetyladalin''', is a hypnotic and sedative drug of the ureide (acylurea) group discovered by Bayer in 1917<ref>{{cite patent | country = DE | number = 327129 | title = Verfahren zur Darstellung von Derivaten bromacylierter Harnstoffe (Procedures for the preparation of derivatives of bromoacylated urea) | assign1 = Bayer AG | gdate = 5 October 1920 }}</ref> that was formerly marketed in the United States and Europe.<ref name="Elks2014">{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA2|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=2–}}</ref><ref>{{cite book|title=Index Nominum 2000: International Drug Directory|url=https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA4|date=January 2000|publisher=Taylor & Francis|isbn=978-3-88763-075-1|pages=4–}}</ref> It is also used in combination with extract of quebracho and vitamin E as a treatment for erectile dysfunction under the brand name '''Afrodor''' in Europe.<ref name="Muller1998">{{cite book| veditors = Muller NF, Dessing RP |title=European Drug Index: European Drug Registrations, Fourth Edition|url=https://books.google.com/books?id=HiSdvzs2pPAC&pg=PA36|date=19 June 1998|publisher=CRC Press|isbn=978-3-7692-2114-5|pages=36–}}</ref><ref>{{cite journal | vauthors = Baumbusch F, Papp GK, Kopa ZS | title = Treatment for potency problems with Afrodor 2000 | journal = Acta Chirurgica Hungarica | volume = 35 | issue = 1–2 | pages = 87–92 | year = 1995 | pmid = 8659243 }}</ref><ref>{{cite journal | vauthors = Sperling H, Lümmen G, Luboldt HJ, Rübben H | title = [Secondary erectile dysfunction. Is oral medication in the diagnostic phase indicated?] | journal = Der Urologe. Ausg. A | volume = 38 | issue = 1 | pages = 56–9 | date = January 1999 | pmid = 10081103 | doi = 10.1007/s001200050246 | s2cid = 24907635 }}</ref> Acecarbromal is structurally related to the barbiturates, which are basically cyclized ureas.<ref name="WilliamsFoye2002">{{cite book| first1 = David A. | last1 = Williams | first2 = William O. | last2 = Foye | first3 = Thomas L. | last3 = Lemke | name-list-style = vanc |title=Foye's Principles of Medicinal Chemistry|url=https://books.google.com/books?id=KGLF4ZudTyAC&pg=PA380|date=January 2002|publisher=Lippincott Williams & Wilkins|isbn=978-0-683-30737-5|pages=380–}}</ref> Prolonged use is not recommended as it can cause bromine poisoning.<ref name="WilliamsFoye2002" />
== See also == * Bromisoval * Carbromal
== References == {{Reflist|2}}
==Further reading== * [https://precision.fda.gov/ginas/app/ui/substances/E47C56IGOY Acecarbromal] * [https://pharmanah.de Pharmanah] (in German)
{{Hypnotics and sedatives}} {{Drugs for erectile dysfunction and premature ejaculation}} {{GABAAergics}}
Category:Erectile dysfunction drugs Category:GABAA receptor positive allosteric modulators Category:Hypnotics Category:Organobromides Category:Sedatives Category:Ureas Category:Drugs developed by Bayer
{{sedative-stub}}