Xylopine

{{Chembox | ImageFile = Xylopine.svg | ImageClass = skin-invert-image | ImageSize = 150px | ImageAlt = | IUPACName = 9-Methoxy-2′''H''-12-nor-[1,3]dioxolo[4′,5′:1,2]-6aβ-aporphine | SystematicName = (7a''R'')-10-Methoxy-6,7,7a,8-tetrahydro-2''H'',5''H''-benzo[''g''][1,3]benzodioxolo[6,5,4-''de'']quinoline | OtherNames = |Section1={{Chembox Identifiers | CASNo = 517-71-5 | CASNo_Ref = {{cascite|correct|CAS}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = NNZ7TH999H | PubChem = 160503 | ChemSpiderID = 141042 | ChEBI = 10083 | KEGG = C09670 | InChI = 1S/C18H17NO3/c1-20-12-2-3-13-11(6-12)7-14-16-10(4-5-19-14)8-15-18(17(13)16)22-9-21-15/h2-3,6,8,14,19H,4-5,7,9H2,1H3/t14-/m1/s1 | InChIKey = RFWCCZDSXIZJMF-CQSZACIVSA-N | SMILES = COC1=CC2=C(C=C1)C3=C4[C@@H](C2)NCCC4=CC5=C3OCO5}} |Section2={{Chembox Properties | C=18 | H=17 | N=1 | O=3 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}

'''Xylopine''' is an antimicrobial benzylisoquinoline alkaloid.<ref>{{cite journal|pmid=3615557|year=1987|last1=Villar|first1=A|last2=Mares|first2=M|last3=Rios|first3=JL|last4=Canton|first4=E|last5=Gobernado|first5=M|title=Antimicrobial activity of benzylisoquinoline alkaloids|volume=42|issue=4|pages=248–50|journal=Die Pharmazie}}</ref>

Xylopine is a noraporphine alkaloid that occurs in ''Xylopia discreta''<ref>{{cite journal | vauthors=((Schmutz, J.)) | journal=Helvetica Chimica Acta | title=Die Alkaloide von Xylopia discreta (L. FIL. ) S PRAGUE et HUTCHINS . | volume=42 | issue=1 | pages=335–343 | date= January 1959 | doi=10.1002/hlca.19590420130 | bibcode=1959HChAc..42..335S }}</ref>

==References== {{reflist}}

Category:Aporphine alkaloids Category:Methoxy compounds Category:Methylenedioxyphenethylamines Category:Noraporphines

{{Alkaloid-stub}}