Oil Blue A

{{Chembox | ImageFile = OilBlueA.svg | ImageSize = 200px | ImageName = Skeletal formula | ImageFile1 = Oil Blue A 3D ball.png | ImageSize1 = 210px | ImageName1 = Ball-and-stick model | PIN = 1,4-Bis[(propan-2-yl)amino]anthracene-9,10-dione | OtherNames = {{unbulleted list|Unisol Blue AS|Solvent Blue 36|Solvent Blue A|Oil Blue G|Blue AP|CI 61551}} |Section1={{Chembox Identifiers | CASNo = 14233-37-5 | CASNo_Ref = {{cascite|correct|CAS}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = NEH7L3Y1P1 | EINECS = 238-101-9 | PubChem = 61719 | ChemSpiderID = 55619 | SMILES = O=C2c1ccccc1C(c3c2c(NC(C)C)ccc3NC(C)C)=O | InChI = 1/C20H22N2O2/c1-11(2)21-15-9-10-16(22-12(3)4)18-17(15)19(23)13-7-5-6-8-14(13)20(18)24/h5-12,21-22H,1-4H3 | InChIKey = BLFZMXOCPASACY-UHFFFAOYAP | StdInChI = 1S/C20H22N2O2/c1-11(2)21-15-9-10-16(22-12(3)4)18-17(15)19(23)13-7-5-6-8-14(13)20(18)24/h5-12,21-22H,1-4H3 | StdInChIKey = BLFZMXOCPASACY-UHFFFAOYSA-N | RTECS = | MeSHName = C018468

}} |Section2={{Chembox Properties | C=20 | H=22 | N=2 | O=2 | Appearance = | Density = | MeltingPtC = 133-135 | BoilingPt = | Solubility = insoluble | SolubleOther = [[acetone]], [[benzene]], and [[toluene]] }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}

'''Oil Blue A''' is a blue [[anthraquinone dye]]<ref name=":0">{{Cite web |title=Oil Blue A - Royce Global |url=https://polymer-additives.specialchem.com/product/p-royce-global-oil-blue-a |access-date=2022-11-23 |website=polymer-additives.specialchem.com |language=en}}</ref> used for [[plastic colorant|colouring]] certain [[plastics]] such as [[polystyrene]] and [[acrylic resin]]s, as well as other materials such as [[petroleum]] and [[ink]]s. It has good [[photostability|resistance to light]].<ref name=":0" />

==See also== * [[Oil Blue 35]]

==References== {{reflist}}

[[Category:Solvent dyes]] [[Category:Anthraquinone dyes]] [[Category:Aromatic amines]]