{{cs1 config|name-list-style=vanc|display-authors=6}} {{Drugbox | IUPAC_name = (3aS,6aR)-2-(oxan-4-ylmethyl)-N-[6-(2,3,5-trifluorophenyl)pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine | image = VU6028418.svg | image_class = skin-invert-image | width =
<!--Clinical data--> | tradename = | routes_of_administration =
<!--Identifiers--> | CAS_number = 2649803-05-2 | UNII = | ATC_prefix = | PubChem = 164606754 | IUPHAR_ligand = | ChemSpiderID = 129431227 | ChEMBL = 4850236
<!--Chemical data--> | C=23 | H=27 | F=3 | N=4 | O=1 | smiles = C1COCCC1CN2C[C@H]3CC(C[C@H]3C2)NC4=NN=C(C=C4)C5=C(C(=CC(=C5)F)F)F | StdInChI = 1S/C23H27F3N4O/c24-17-9-19(23(26)20(25)10-17)21-1-2-22(29-28-21)27-18-7-15-12-30(13-16(15)8-18)11-14-3-5-31-6-4-14/h1-2,9-10,14-16,18H,3-8,11-13H2,(H,27,29)/t15-,16+,18? | StdInChIKey = ITSKPCHXUYILTR-BYICEURKSA-N }}
'''VU6028418''' is an experimental drug that acts as a potent and selective antagonist of the Muscarinic acetylcholine receptor M4. It has been investigated for the treatment of dystonia and other movement disorders.<ref>{{cite journal | vauthors = Spock M, Carter TR, Bollinger KA, Han C, Baker LA, Rodriguez AL, Peng L, Dickerson JW, Qi A, Rook JM, O'Neill JC, Watson KJ, Chang S, Bridges TM, Engers JL, Engers DW, Niswender CM, Conn PJ, Lindsley CW, Bender AM | title = Discovery of VU6028418: A Highly Selective and Orally Bioavailable M<sub>4</sub> Muscarinic Acetylcholine Receptor Antagonist | journal = ACS Medicinal Chemistry Letters | volume = 12 | issue = 8 | pages = 1342–1349 | date = August 2021 | pmid = 34413964 | pmc = 8366002 | doi = 10.1021/acsmedchemlett.1c00363 }}</ref>
== References == {{Reflist}}
Category:Experimental drugs Category:Pyrrolidines Category:Pyridazines Category:Fluoroarenes Category:Tetrahydropyrans Category:Cyclopentapyrroles
{{pharm-stub}}