{{cs1 config|name-list-style=vanc|display-authors=6}} {{Infobox drug | IUPAC_name = (3E,5E)-3,5-bis[(4-fluoro-3-nitrophenyl)methylidene]-1-prop-2-enoylazepan-4-one | image = VLX1570_structure.png | image_class = skin-invert-image | width = 240
<!--Clinical data--> | tradename = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = | legal_UK = | legal_US = <!-- Schedule I / Schedule II / Schedule III --> | legal_status = | routes_of_administration =
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | excretion =
<!--Identifiers--> | CAS_number = 1956378-23-6 | UNII = | PubChem = 71523377 | IUPHAR_ligand = | DrugBank = | ChemSpiderID = | ChEBI = | ChEMBL = | StdInChI = 1S/C23H17F2N3O6/c1-2-22(29)26-8-7-16(9-14-3-5-18(24)20(11-14)27(31)32)23(30)17(13-26)10-15-4-6-19(25)21(12-15)28(33)34/h2-6,9-12H,1,7-8,13H2/b16-9+,17-10+ | StdInChIKey = SCKXBVLYWLLALY-CZCYGEDCSA-N <!--Chemical data--> | C=23 | H=17 | F=2 | N=3 | O=6 | smiles = C=CC(=O)N1CC/C(=C\C2=CC(=C(C=C2)F)[N+](=O)[O-])/C(=O)/C(=C/C3=CC(=C(C=C3)F)[N+](=O)[O-])/C1 }}
'''VLX1570''' is a drug used in scientific research which acts as a non selective inhibitor of proteasome deubiquitinases. It has potential applications in the treatment of cancer, though was discontinued in clinical trials due to excessive toxicity.<ref>{{cite journal | vauthors = Stanton C, Sun J, Nutsch K, Rosarda JD, Nguyen T, Li-Ma C, Njomen E, Melillo B, Kutseikin S, Saez E, Cravatt BF, Teijaro JR, Wiseman RL, Bollong MJ | title = Covalent Targeting As a Common Mechanism for Inhibiting NLRP3 Inflammasome Assembly | journal = ACS Chemical Biology | volume = 19 | issue = 2 | pages = 254–265 | date = February 2024 | pmid = 38198472 | doi = 10.1021/acschembio.3c00330 | pmc = 11131128 }}</ref><ref>{{cite journal | vauthors = Bazzaro M, Linder S | title = Dienone Compounds: Targets and Pharmacological Responses | journal = Journal of Medicinal Chemistry | volume = 63 | issue = 24 | pages = 15075–15093 | date = December 2020 | pmid = 33146523 | doi = 10.1021/acs.jmedchem.0c00812 | pmc = 7770821 }}</ref><ref>{{cite journal | vauthors = Rowinsky EK, Paner A, Berdeja JG, Paba-Prada C, Venugopal P, Porkka K, Gullbo J, Linder S, Loskog A, Richardson PG, Landgren O | title = Phase 1 study of the protein deubiquitinase inhibitor VLX1570 in patients with relapsed and/or refractory multiple myeloma | journal = Investigational New Drugs | volume = 38 | issue = 5 | pages = 1448–1453 | date = October 2020 | pmid = 32125598 | doi = 10.1007/s10637-020-00915-4 | pmc = 7497669 }}</ref><ref>{{cite journal | vauthors = Wang J, Du T, Lu Y, Lv Y, Du Y, Wu J, Ma R, Xu C, Feng J | title = VLX1570 regulates the proliferation and apoptosis of human lung cancer cells through modulating ER stress and the AKT pathway | journal = Journal of Cellular and Molecular Medicine | volume = 26 | issue = 1 | pages = 108–122 | date = January 2022 | pmid = 34854221 | doi = 10.1111/jcmm.17053 | pmc = 8742231 }}</ref>
== References == {{reflist}}
{{pharm-stub}}
Category:Proteasome inhibitors