{{chembox | Verifiedfields = changed | verifiedrevid = 425029276 | ImageFile=U46619.png | ImageSize=200px | PIN=(5''Z'')-7-<nowiki/>{(1''R'',4''S'',5''S'',6''R'')-6-[(1''E'',3''S'')-3-Hydroxyoct-1-en-1-yl]-2-oxabicyclo[2.2.1]heptan-5-yl}hept-5-enoic acid | OtherNames= |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|??}} | CASNo=56985-40-1 | ChEBI = 92336 | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 357834 | ChemSpiderID = 24719087 | EINECS = 637-219-1 | IUPHAR_ligand = 1888 | PubChem=5311493 | StdInChI=1S/C21H34O4/c1-2-3-6-9-17(22)12-13-19-18(16-14-20(19)25-15-16)10-7-4-5-8-11-21(23)24/h4,7,12-13,16-20,22H,2-3,5-6,8-11,14-15H2,1H3,(H,23,24)/b7-4-,13-12+/t16-,17+,18+,19-,20-/m1/s1 | StdInChIKey = LQANGKSBLPMBTJ-BRSNVKEHSA-N | SMILES=CCCCC[C@H](O)/C=C/[C@H]1[C@@H]2OC[C@@H](C2)[C@@H]1C/C=C\CCCC(O)=O }} |Section2={{Chembox Properties | Formula=C<sub>21</sub>H<sub>34</sub>O<sub>4</sub> | MolarMass=350.49 g/mol | Appearance= | Density= | MeltingPt= | BoilingPt= | Solubility= }} |Section3={{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt = }} }}
'''U46619''' is a stable synthetic analog of the endoperoxide prostaglandin PGH<sub>2</sub> first prepared in 1975,<ref>{{cite journal | author = Bundy, G. L. | title = Synthesis of prostaglandin endoperoxide analogs | journal = Tetrahedron Letters | year = 1975 | volume = 16 | pages = 1957–1960 | doi = 10.1016/S0040-4039(00)72333-1 | issue = 24}}</ref> and acts as a thromboxane A<sub>2</sub> (TP) receptor agonist. It potently stimulates TP receptor-mediated, but not other prostaglandin receptor-mediated responses in various in vitro preparations and exhibits many properties similar to thromboxane A<sub>2</sub>, including shape change and aggregation of platelets <ref>{{cite journal | title=Binding of a thromboxane A2/prostaglandin H2 agonist [3H]U46619 to washed human platelets |author1=Liel, N. |author2=Mais, D.E. |author3=Halushka, P.V | journal = Prostaglandins | year=1987 |volume=33|issue=6 |pages= 789–797 | doi=10.1016/0090-6980(87)90107-9|pmid=2959986 }}</ref> and smooth muscle contraction. U46619 is a vasoconstrictor that mimics the hydroosmotic effect of vasopressin.<ref>{{cite journal | title = Calcium-45 fluxes in isolated toad bladder epithelial cells: effects of agents which alter water or sodium transport |author1=Burch, Ronald M. |author2=Halushka, Perry V. | journal = Journal of Pharmacology and Experimental Therapeutics |year=1983|volume =224|issue=1|pages= 108–17 |doi=10.1016/S0022-3565(25)33438-5 | pmid = 6294273}}</ref>
==References== {{Reflist}}
{{Prostanoidergics}}
Category:Prostaglandins Category:Carboxylic acids
{{Molecular-biology-stub}}