{{short description|Chemical compound}} {{Drugbox | verifiedrevid = 396516252 | IUPAC_name = 3-fluoro-7-(2,2,2-trifluoroethoxy)phenoxathiine 10,10-dioxide | image = CX157 structure.svg | image_class = skin-invert-image
<!--Clinical data--> | tradename = | pregnancy_category = | legal_status = Uncontrolled | routes_of_administration = Oral
<!--Pharmacokinetic data--> | bioavailability = | metabolism = | elimination_half-life = | excretion =
<!--Identifiers--> | CAS_number = 205187-53-7 | CAS_number_Ref = {{cascite|correct|CAS}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = O6L62LZJ0Q | ATC_prefix = none | ATC_suffix = | PubChem = 18687754 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 13701383
<!--Chemical data--> | C = 14 | H = 8 | F = 4 | O = 4 | S = 1 | smiles = FC(F)(F)COc2cc3Oc1cc(F)ccc1S(=O)(=O)c3cc2 | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C14H8F4O4S/c15-8-1-3-12-10(5-8)22-11-6-9(21-7-14(16,17)18)2-4-13(11)23(12,19)20/h1-6H,7H2 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = PDIMOTRDGUQMNY-UHFFFAOYSA-N }}
'''CX157''' (proposed trade name '''TriRima''', formerly '''Tyrima''') is a selective and reversible inhibitor of MAO-A (RIMA).<ref>{{cite conference |vauthors=Fielding R, Mielach F, Free J, Pande A |title=Pharmacokinetics and oral bioavailability of CX157, a reversible selective MAO-A inhibitor, in primates |year=2007 |conference=2007 AAPS Annual Meeting & Exposition |url=http://www.aapsj.org/abstracts/AM_2007/AAPS2007-001233.PDF |accessdate=2009-06-14 |archive-url=https://web.archive.org/web/20110526192425/http://www.aapsj.org/abstracts/AM_2007/AAPS2007-001233.PDF |archive-date=2011-05-26 |url-status=dead }}</ref> As of 2007 it was in phase II clinical trials for the treatment of depression.<ref>{{ClinicalTrialsGov|NCT00739908}|A Study of CX157 (TriRima) for the Treatment of Depression (CX157-200)}}</ref> In 2013, work on the drug was terminated.[http://adisinsight.springer.com/drugs/800025697]
==References== {{Reflist|2}}
{{Monoamine metabolism modulators}}
Category:Reversible inhibitors of MAO-A Category:Monoamine oxidase inhibitors Category:Abandoned drugs Category:Sulfur heterocycles Category:Trifluoromethyl compounds Category:Fluoroarenes Category:Sulfones Category:Oxygen heterocycles Category:Heterocyclic compounds with 3 rings
{{nervous-system-drug-stub}}