{{Chembox | ImageFile = Trifluoroethylene.svg | ImageSize = 150px | ImageAlt = | IUPACName = Trifluoroethene | OtherNames = | Section1 = {{Chembox Identifiers | CASNo = 359-11-5 | ChemSpiderID = 9284 | EINECS = 206-626-2 | PubChem = 9665 | UNII = Z2866M3Z1A | StdInChI=1S/C2HF3/c3-1-2(4)5/h1H | StdInChIKey = MIZLGWKEZAPEFJ-UHFFFAOYSA-N | SMILES = C(=C(F)F)F }} | Section2 = {{Chembox Properties | C=2|H=1|F=3 | Appearance = Colourless gas | Density = 1.26 g/cm<sup>3</sup> (liquid, at –70 °C)<ref name=crc/> | MeltingPt = | BoilingPtC = -51 | SolubleOther = soluble in [[diethyl ether|ether]], slightly soluble in [[ethanol]]<ref name=crc/> }} | Section3 = {{Chembox Hazards | GHS_ref=<ref>{{cite web |title=Trifluoroethylene |url=https://pubchem.ncbi.nlm.nih.gov/compound/9665#section=Safety-and-Hazards |website=pubchem.ncbi.nlm.nih.gov |language=en}}</ref> | GHSPictograms = {{GHS02}}{{GHS04}} | GHSSignalWord = Danger | HPhrases = {{H-phrases|220|280}} | PPhrases = {{P-phrases|203|210|222|280|377|381|403|410+403}} | MainHazards = | FlashPt = | AutoignitionPt = }} | Section9 = {{Chembox Related | OtherAnions = | OtherCations = | OtherFunction = [[Vinyl fluoride]], [[vinylidene fluoride]], [[tetrafluoroethylene]], [[trichloroethylene]] | OtherFunction_label = Vinyl halides | OtherCompounds = }} }} '''Trifluoroethylene''' (abbreviated as '''TrFE'''<ref>{{cite journal| title=Synthesis and properties of poly(trifluoroethylene) ''via'' a persistent radical mediated polymerization of trifluoroethylene| date=2018| last1=Colpaert| first1=Maxime| last2=Banerjee| first2=Sanjib| last3=Ladmiral| first3=Vincent| last4=Ono| first4=Taizo| last5=Améduri| first5=Bruno| journal=Polymer Chemistry| volume=9| issue=7| pages=894–903| doi=10.1039/c7py02018j}}</ref>) is an [[organofluoride]] compound with the chemical formula {{chem2|C2HF3}}. It is a colourless gas.<ref name=crc>Lide, D.R. CRC Handbook of Chemistry and Physics 88TH Edition 2007-2008. CRC Press, Taylor & Francis, Boca Raton, FL 2007, p. 3-500</ref> TrFE can polymerise to form [[poly(trifluoroethylene)]] (PTrFE). It can also form [[homopolymer|copolymer]]s with other monomers, such as [[vinylidene fluoride]] to form a co-polymer that is used to produce [[ferroelectric material]]s.<ref>{{cite journal| title=NMR investigations of polytrifluoroethylene (PTrFE) synthesized by RAFT| date=2021| last1=Bouad| first1=Vincent| last2=Guerre| first2=Marc| last3=Zeliouche| first3=Sami| last4=Améduri| first4=Bruno| last5=Totée| first5=Cédric| last6=Silly| first6=Gilles| last7=Poli| first7=Rinaldo| last8=Ladmiral| first8=Vincent| journal=Polymer Chemistry| volume=12| issue=15| pages=2293–2304| doi=10.1039/d0py01753a| url=https://hal.archives-ouvertes.fr/hal-03188630/file/423-10.1039-D0PY01753A-accepted.pdf}}</ref>
==References== {{reflist}}
[[Category:Monomers]] [[Category:Fluoroalkenes]] [[Category:Hydrofluoroolefins]]