| Verifiedfields | changed |
|---|---|
| Watchedfields | changed |
| Verifiedrevid | 470608964 |
| Iupac name | (±)-2-[(2-benzyl-3-sulfanyl-propanoyl)amino]acetic acid |
| Width | 200px |
| Chirality | Racemic mixture |
| Cas number | 76721-89-6 |
| Atc prefix | none |
| Stdinchi | 1S/C12H15NO3S/c14-11(15)7-13-12(16)10(8-17)6-9-4-2-1-3-5-9/h1-5,10,17H,6-8H2,(H,13,16)(H,14,15) |
| Stdinchikey | LJJKNPQAGWVLDQ-UHFFFAOYSA-N |
| Pubchem | 3132 |
| Drugbank | DB08626 |
| Unii | B79L7B5X3Z |
| Chemspiderid | 3020 |
| Chembl | 10247 |
| Kegg | C01619 |
| C | 12 |
| H | 15 |
| N | 1 |
| O | 3 |
| S | 1 |
| Smiles | C1=CC=C(C=C1)CC(CS)C(=O)NCC(=O)O |
Thiorphan is the active metabolite of the antidiarrheal racecadotril (acetorphan).[1] It prevents the degradation of endogenous enkephalins by acting as an enkephalinase inhibitor.[1][2]
References
- ^ Spillantini MG, Geppetti P, Fanciullacci M, Michelacci S, Lecomte JM, Sicuteri F (June 1986). "In vivo 'enkephalinase' inhibition by acetorphan in human plasma and CSF". European Journal of Pharmacology. 125 (1): 147–50. doi:10.1016/0014-2999(86)90094-4. PMID 3015640
- ^ Matheson AJ, Noble S (April 2000). "Racecadotril". Drugs. 59 (4): 829–35; discussion 836–7. doi:10.2165/00003495-200059040-00010. PMID 10804038. S2CID 245710392