{{Short description|Chemical compound}} {{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 444438134 | IUPAC_name = ''S''-[(1''S'',7''R'',8''S'',9''S'',10''R'',13''S'',14''S'',17''S'')-1-acetylsulfanyl-17-hydroxy-10,13,17-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1''H''-cyclopenta[a]phenanthren-7-yl] ethanethioate | image = Tiomesterone structure.svg | image_class = skin-invert-image | width = 250
<!--Clinical data--> | tradename = Emdabol, Embadol, Emdabolin, Protabol | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = Oral
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
<!-- Identifiers --> | CAS_number_Ref = {{cascite|correct|??}} | CAS_number = 2205-73-4 | CAS_supplemental = | ATC_prefix = | ATC_suffix = | ATC_supplemental = | PubChem = 16626 | IUPHAR_ligand = | DrugBank_Ref = | DrugBank = | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 15763 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = W5K3712F4H | KEGG = | ChEBI = | ChEMBL =
<!--Chemical data--> | C=24 | H=34 | O=4 | S=2 | SMILES=CC(=O)S[C@@H]1CC2=CC(=O)C[C@@H]([C@@]2([C@@H]3[C@@H]1[C@@H]4CC[C@]([C@]4(CC3)C)(C)O)C)SC(=O)C | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C24H34O4S2/c1-13(25)29-19-11-15-10-16(27)12-20(30-14(2)26)24(15,5)18-6-8-22(3)17(21(18)19)7-9-23(22,4)28/h10,17-21,28H,6-9,11-12H2,1-5H3/t17-,18-,19+,20-,21-,22-,23-,24-/m0/s1 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = YUOZKOLALXNELS-SQVYRKCQSA-N | synonyms = Thiomesterone; Thiomestrone; StA 307 }}
'''Tiomesterone''' (INN, JAN; '''thiomesterone''' (BAN); also known as '''1α,7α-bis(acetylthio)-17α-methylandrost-4-en-17β-ol-3-one'''; developmental code '''StA 307'''; brand names '''Emdabol''', '''Embadol''', '''Emdabolin''', and '''Protabol''') is a synthetic, orally active anabolic-androgenic steroid (AAS) and a 17α-alkylated derivative of testosterone.<ref name="Elks2014">{{cite book | vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PR2|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|page=1188}}</ref> It was described in 1963.<ref name="Elks2014" />
==References== {{Reflist|2}}
{{Androgens and antiandrogens}} {{Androgen receptor modulators}}
Category:Androgens Category:Androstanes Category:Hepatotoxins Category:Thioesters
{{Androgen-stub}} {{genito-urinary-drug-stub}}