{{Chembox | ImageFile = Thelephoric acid.svg | ImageSize = 220 | ImageAlt = Structural formula of thelephoric acid | ImageFile1 = Thelephoric acid 3D spacefill.png | ImageAlt1 = Space-filling model of the thelephoric acid molecule | PIN = 2,3,8,9-Tetrahydroxybenzo[1,2-''b'':4,5-''b''′]bis([1]benzofuran)-6,12-dione | OtherNames = |Section1={{Chembox Identifiers | CASNo = 479-64-1 | CASNo_Ref = {{Cascite|changed|CAS}} | ChEMBL = 3236668 | ChEBI = 144238 | PubChem = 135464206 | ChemSpiderID = 30776833 | SMILES = c1c2c(cc(c1O)O)oc3c2C(=O)c4c(c5cc(c(cc5o4)O)O)C3=O | InChI = 1/C18H8O8/c19-7-1-5-11(3-9(7)21)25-17-13(5)15(23)18-14(16(17)24)6-2-8(20)10(22)4-12(6)26-18/h1-4,19-22H | InChIKey = PDICCECAPKBDBB-UHFFFAOYAC | StdInChI = 1S/C18H8O8/c19-7-1-5-11(3-9(7)21)25-17-13(5)15(23)18-14(16(17)24)6-2-8(20)10(22)4-12(6)26-18/h1-4,19-22H | StdInChIKey = PDICCECAPKBDBB-UHFFFAOYSA-N }} |Section2={{Chembox Properties | C=18 | H=8 | O=8 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}
'''Thelephoric acid''' is a terphenylquinone pigment that is found in several fungi, such as ''Omphalotus subilludens''<ref name="Sullivan 1971"/> and ''Polyozellus multiplex''.<ref name="Ju-Yeon 1999"/> Thelephoric acid has been shown to inhibit prolyl endopeptidase, an enzyme that has a role in processing proteins (specifically, amyloid precursor protein) in Alzheimer's disease. Chemicals that inhibit prolyl endopeptidase have attracted research interest due to their potential therapeutic effects.<ref name="Hwang 1997"/><ref name="Nagasawa 2014"/> It is derived from atromentin, and its precursor can be from cyclovariegatin. Fragmentation patterns have suggested that polymers of thelephoric acid exists.
==References== {{Reflist|refs=
<ref name="Hwang 1997">{{Cite journal |vauthors=Hwang JS, Song KS, Kim WG, Lee TH, Koshino H, Yoo ID |title=Polyozellin, a new inhibitor of prolyl endopeptidase from ''Polyozellus multiplex'' |journal=The Journal of Antibiotics |volume=50 |issue=9 |pages=773–77 |year=1997 |pmid=9360624 |doi=10.7164/antibiotics.50.773|doi-access=free }}</ref>
<ref name="Ju-Yeon 1999">{{Cite journal |vauthors=Ju-Yeon K, ((Rhee I-K)), ((Lee K-B)), ((Hwang J-S)), ((Yoo I-D)), ((Song K-S)) |year=1999 |title=Thelephoric acid and kynapcin-9 in mushroom ''Polyozellus multiflex'' inhibit prolyl endopeptidase ''in vitro'' |journal=Journal of Microbiology and Biotechnology |volume=9 |issue=6 |pages=798–803}}</ref>
<ref name="Nagasawa 2014">{{Cite journal |vauthors=Nagasawa I, Kaneko A, Suzuki T, Nishio K, Kinoshita K, Shiro M, Koyama K |title=Potential anti-angiogenesis effects of ''p''-terphenyl compounds from ''Polyozellus multiplex'' |journal=Journal of Natural Products |year=2014 |volume=77 |issue=4 |pages=963–8 |doi=10.1021/np401046z |pmid=24601669 |bibcode=2014JNAtP..77..963N }}</ref>
<ref name="Sullivan 1971">{{Cite journal |vauthors=Sullivan G, Garrett RD, Lenehan RF |year=1971 |title=Occurrence of atromentin and thelephoric acid in cultures of ''Clitocybe subilludens'' |journal=Journal of Pharmaceutical Sciences |volume=60 |issue=11 |pages=1727–29 |doi=10.1002/jps.2600601134 |pmid=4332377 |bibcode=1971JPhmS..60.1727S }}</ref>
}}
Category:Tetrols Category:Quinones Category:Hydrolase inhibitors Category:Catechols Category:Dibenzofurans Category:Heterocyclic compounds with 5 rings Category:Aromatic ketones Category:Fungal pigments