{{Chembox | ImageFile = Stemodene.svg | ImageSize = 180px | IUPACName = (14''S'')-9,15:14,20-Dicyclo-8α-labd-13(16)-ene | SystematicName = (4a''S'',6a''S'',8''S'',11a''R'',11b''S'')-4,4,11b-Trimethyl-9-methylidenetetradecahydro-8,11a-methanocyclohepta[''a'']naphthalene | OtherNames = |Section1={{Chembox Identifiers | CASNo = 929635-55-2 | CASNo_Ref = {{cascite|correct|}} UNII_Ref = {{fdacite|correct|FDA}} | UNII = B473VDT3WP | Beilstein = 10812290 | ChEBI = 50068 | KEGG = C18224 | PubChem = 24798689 | ChemSpiderID = 24785627 | SMILES = [H][C@@]12CC[C@@]3([H])C(C)(C)CCC[C@]3(C)[C@]1(CCC4=C)C[C@@H]4C2 | InChI = InChI=1S/C20H32/c1-14-8-11-20-13-15(14)12-16(20)6-7-17-18(2,3)9-5-10-19(17,20)4/h15-17H,1,5-13H2,2-4H3/t15-,16-,17-,19-,20+/m0/s1 | InChIKey = GNNRCBBKCVNPSC-VDWQKOAOSA-N }} |Section2={{Chembox Properties | C=20 | H=32 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}
'''Stemodene''' is a labdane-related diterpene whose corresponding class I terpene synthase has been discovered in rice and subsequently cloned and functionally characterized. The gene responsible for stemodene production has not been found in the completed rice genome, thus suggesting that perhaps other genes are as yet undiscovered in the "completed" genome. Stemarene synthase demonstrates high sequence homology with stemodene synthase, thus accounting for the latter's discovery by Dana Morrone in 2005.<ref name=Morrone_et_al_2005>{{cite journal | last = Morrone | first = Dana |author2=Yinghua Jin |author3=Meimei Xu |author4=Suh-Yeon Choi |author5=Robert M. Coates |author6=Reuben J. Peters | date = April 15, 2006 | title = An unexpected diterpene cyclase from rice: functional identification of a stemodene synthase | journal = Archives of Biochemistry and Biophysics | volume = 448 | issue = 1–2 | pages = 133–140 | doi = 10.1016/j.abb.2005.09.001 | pmid = 16256063 | url = http://www.aseanbiotechnology.info/Abstract/21019013.pdf|archive-url=https://web.archive.org/web/20070928091832/http://www.aseanbiotechnology.info/Abstract/21019013.pdf|url-status=usurped | access-date = 2006-11-07| archive-date = 2007-09-28 }}</ref> Additionally, the corresponding olefin produced by each cyclase shows structural similarities and is derived from the common precursor of ''syn''-copalyl diphosphate.
== References == {{reflist}}
Category:Diterpenes Category:Cyclopentanes
{{Organic-compound-stub}}