{{Short description|Chemical compound}} {{cs1 config|name-list-style=vanc|display-authors=6}} {{Infobox drug | drug_name = | image = Sepetaprost.svg | image_class = skin-invert-image | width = | caption =
<!-- Clinical data --> | pronounce = | tradename = | Drugs.com = | MedlinePlus = | licence_CA = | licence_EU = | DailyMedID = | licence_US = | pregnancy_AU = | pregnancy_category = | dependency_liability = | addiction_liability = | routes_of_administration = | class = | ATC_prefix = | ATC_suffix =
<!-- Legal status --> | legal_status = Investigational
<!-- Pharmacokinetic data --> | bioavailability = | protein_bound = | metabolism = | metabolites = | onset = | elimination_half-life = | duration_of_action = | excretion =
<!-- Identifiers --> | CAS_number = 1262873-06-2 | CAS_supplemental = | PubChem = 50902259 | IUPHAR_ligand = 9875 | DrugBank = DB12043 | ChemSpiderID = 32698273 | UNII = 79O7855J4G | KEGG = D12617 | ChEBI = | ChEMBL = 4297633 | NIAID_ChemDB = | PDB_ligand = | synonyms = STN-1012600
<!-- Chemical data --> | IUPAC_name = propan-2-yl 4-[(3S,5aR,6R,7R,8aS)-6-[(E,3R)-4-(2,5-difluorophenoxy)-3-hydroxybut-1-enyl]-7-hydroxy-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]butanoate | C=26 | H=36 | F=2 | O=6 | SMILES = CC(C)OC(=O)CCC[C@H]1CC[C@H]2[C@H](C[C@H]([C@@H]2/C=C/[C@H](COC3=C(C=CC(=C3)F)F)O)O)OC1 | StdInChI = 1S/C26H36F2O6/c1-16(2)34-26(31)5-3-4-17-6-9-21-20(23(30)13-24(21)32-14-17)10-8-19(29)15-33-25-12-18(27)7-11-22(25)28/h7-8,10-12,16-17,19-21,23-24,29-30H,3-6,9,13-15H2,1-2H3/b10-8+/t17-,19+,20+,21+,23+,24-/m0/s1 | StdInChIKey = BKVUSNOUTQMSBE-XCMGCKIWSA-N }} '''Sepetaprost''' is an investigational new drug that is being evaluated for the treatment of open angle glaucoma and ocular hypertension.<ref>{{cite web | title = Sepetaprost - Santen Pharmaceutical | url = https://adisinsight.springer.com/drugs/800035556 | work = AdisInsight | publisher = Springer Nature Switzerland AG }}</ref> It is an agonist of the prostaglandin EP3 and F receptors.<ref name="Sharif_2023">{{cite journal | vauthors = Sharif NA, Odani-Kawabata N, Lu F, Pinchuk L | title = FP and EP2 prostanoid receptor agonist drugs and aqueous humor outflow devices for treating ocular hypertension and glaucoma | journal = Experimental Eye Research | volume = 229 | issue = | article-number = 109415 | date = April 2023 | pmid = 36803996 | doi = 10.1016/j.exer.2023.109415 }}</ref>
As of 2025 Sepetaprost is registered in Japan as Setaneo<ref>{{Cite web |title=Santen Launches SETANEO® |url=https://www.santen.com/en/news/2025/2025_1/20251023 |url-status=live}}</ref> ophthalmic solution 0.002%, sold by Santen Pharmaceuticals. It is indicated for the treatment of glaucoma and ocular hypertension.
== References == {{reflist}}
Category:Oxepanes Category:Fluoroarenes Category:Isopropyl esters Category:Diols
{{Authority control|qid=Q27266770}} {{Pharma-stub}}