{{chembox | Watchedfields = changed | verifiedrevid = 419853772 | Name = Sclarene | ImageFile = Sclarene.svg | ImageName = Sclarene | IUPACName = Labda-8(20),13(16),14-triene | SystematicName = (4a''S'',5''S'',8a''S'')-1,1,4a-Trimethyl-6-methylidene-5-(3-methylidenepent-4-en-1-yl)decahydronaphthalene | Section1 = {{Chembox Identifiers | CASNo_Ref = {{cascite|correct|CAS}} | CASNo = 511-02-4
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 95E3AV9Y7E | ChEBI = 64281 | ChemSpiderID = 9498211 | PubChem = 11323257 | StdInChI=1S/C20H32/c1-7-15(2)9-11-17-16(3)10-12-18-19(4,5)13-8-14-20(17,18)6/h7,17-18H,1-3,8-14H2,4-6H3/t17-,18-,20+/m0/s1 | StdInChIKey = KYLKKZSVPLUGCC-CMKODMSKSA-N | SMILES = C[C@]12CCCC([C@@H]1CCC(=C)[C@@H]2CCC(=C)C=C)(C)C }} | Section2 = {{Chembox Properties | C=20|H=32 | Density = | MeltingPt = | BoilingPt = }} }}
'''Sclarene''' is a diterpene present in the foliage of ''Podocarpus hallii''.<ref>[http://findarticles.com/p/articles/mi_qa4091/is_200307/ai_n9287893/pg_2] {{dead link|date=June 2012}}</ref>
==References== {{reflist}}
Category:Diterpenes Category:Decalins Category:Polyenes Category:Vinylidene compounds
{{organic-compound-stub}}