{{Short description|Organic compound, experimental pharmaceuticum}} {{Drugbox | IUPAC_name = 4-methyl-N-[2-[3-(morpholin-4-ylmethyl)imidazo[2,1-b][1,3]thiazol-6-yl]phenyl]-2-pyridin-3-yl-1,3-thiazole-5-carboxamide | image = SRT2104_structure.png | image_class = skin-invert-image

<!--Clinical data--> | tradename = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_status = | routes_of_administration =

<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

<!--Identifiers--> | CAS_number = 1093403-33-8 | ATC_prefix = | ATC_suffix = | PubChem = 25108829 | ChEMBL = 4297436 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank =DB12186 | ChemSpiderID =28637794 | UNII = 4521NR0J09

<!--Chemical data--> | C=26 | H=24 | N=6 | O=2 | S=2 | smiles = CC1=C(SC(=N1)C2=CN=CC=C2)C(=O)NC3=CC=CC=C3C4=CN5C(=CSC5=N4)CN6CCOCC6 | StdInChI = 1S/C26H24N6O2S2/c1-17-23(36-25(28-17)18-5-4-8-27-13-18)24(33)29-21-7-3-2-6-20(21)22-15-32-19(16-35-26(32)30-22)14-31-9-11-34-12-10-31/h2-8,13,15-16H,9-12,14H2,1H3,(H,29,33) | StdInChIKey = LAMQVIQMVKWXOC-UHFFFAOYSA-N }}

'''SRT-2104''' is an experimental drug that was studied by Sirtris Pharmaceuticals as a small-molecule activator of the sirtuin subtype SIRT1. The compound progressed to Phase II human trials for Type II diabetes before development was discontinued, however it continues to be widely used in animal research into the functions of SIRT1.<ref>{{cite journal | vauthors = Baksi A, Kraydashenko O, Zalevkaya A, Stets R, Elliott P, Haddad J, Hoffmann E, Vlasuk GP, Jacobson EW | display-authors = 6 | title = A phase II, randomized, placebo-controlled, double-blind, multi-dose study of SRT2104, a SIRT1 activator, in subjects with type 2 diabetes | journal = British Journal of Clinical Pharmacology | volume = 78 | issue = 1 | pages = 69–77 | date = July 2014 | pmid = 24446723 | doi = 10.1111/bcp.12327 | pmc = 4168381 }}</ref><ref>{{cite journal | vauthors = Bonkowski MS, Sinclair DA | title = + and sirtuin-activating compounds | journal = Nature Reviews. Molecular Cell Biology | volume = 17 | issue = 11 | pages = 679–690 | date = November 2016 | pmid = 27552971 | doi = 10.1038/nrm.2016.93 | pmc = 5107309 }}</ref><ref>{{cite journal | vauthors = Miyaji N, Nishida K, Tanaka T, Araki D, Kanzaki N, Hoshino Y, Kuroda R, Matsushita T | display-authors = 6 | title = Inhibition of Knee Osteoarthritis Progression in Mice by Administering SRT2014, an Activator of Silent Information Regulator 2 Ortholog 1 | journal = Cartilage | pages = 1356S–1366S | date = January 2020 | volume = 13 | issue = 2_suppl | pmid = 31989845 | doi = 10.1177/1947603519900795 | pmc = 8804762 }}</ref><ref>{{cite journal | vauthors = Gu C, Zhang Q, Ni D, Xiao QF, Cao LF, Fei CY, Ying Y, Li N, Tao F | display-authors = 6 | title = Therapeutic Effects of SRT2104 on Lung Injury in Rats with Emphysema via Reduction of Type II Alveolar Epithelial Cell Senescence | journal = Copd | volume = 17 | issue = 4 | pages = 444–451 | date = August 2020 | pmid = 32722945 | doi = 10.1080/15412555.2020.1797657 | s2cid = 220852823 }}</ref><ref>{{cite journal | vauthors = Lei Y, Wang J, Wang D, Li C, Liu B, Fang X, You J, Guo M, Lu XY | display-authors = 6 | title = SIRT1 in forebrain excitatory neurons produces sexually dimorphic effects on depression-related behaviors and modulates neuronal excitability and synaptic transmission in the medial prefrontal cortex | journal = Molecular Psychiatry | volume = 25 | issue = 5 | pages = 1094–1111 | date = May 2020 | pmid = 30705425 | doi = 10.1038/s41380-019-0352-1 | pmc = 7192847 | doi-access = free }}</ref>

== See also == * SRT-1460 * SRT-1720 * SRT-2183 * SRT2379 * SRT-3025 * STAC-9

== References == {{Reflist}}

Category:Anti-aging substances Category:4-Morpholinyl compounds Category:Thiazoles Category:3-Pyridyl compounds Category:Amides Category:Imidazothiazoles

{{gastrointestinal-drug-stub}}