{{Short description|Chemical compound}} {{Drugbox | IUPAC_name = <nowiki>Methyl 4-{[1-(2-chlorophenyl)-2-oxocyclohexyl]amino}pentanoate</nowiki> | image = SN 35210.svg | image_class = skin-invert-image | width = 220

<!--Clinical data--> | tradename = | legal_status = Investigational new drug | legal_CA = | legal_DE = | legal_UK =

<!--Identifiers--> | CAS_number = 1450615-41-4 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = DS5KFJ4488 | ATC_prefix = none | PubChem = 71769517 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID =

<!--Chemical data--> | C=18 | H=24 | Cl=1 | N=1 | O=3 | StdInChI=1S/C18H24ClNO3/c1-23-17(22)11-5-7-13-20-18(12-6-4-10-16(18)21)14-8-2-3-9-15(14)19/h2-3,8-9,20H,4-7,10-13H2,1H3 | StdInChIKey = QFFBIIVCZDWTKZ-UHFFFAOYSA-N | smiles = Clc1ccccc1C2(NCCCCC(=O)OC)CCCCC2=O }}

'''SN 35210''' is an arylcyclohexylamine dissociative anesthetic drug. It was derived from ketamine with the intention of producing a shorter acting agent more suitable to be used as a stand-alone drug, whereas ketamine itself generally has to be used in combination with other drugs such as midazolam to minimise the occurrence of emergence reactions due to its hallucinogenic side effects. In common with other short-acting anaesthetic drugs such as remifentanil and remimazolam, SN 35210 has had the chemical structure modified to incorporate a methyl ester group which is rapidly metabolised to a carboxylic acid, producing an inactive compound and thus rapidly terminating the effects of the drug. It was selected for development from a series of structurally related alkyl esters due to having the shortest duration of action and the most similar pharmacological profile to ketamine itself.<ref>{{cite journal | vauthors = Jose J, Gamage SA, Harvey MG, Voss LJ, Sleigh JW, Denny WA | title = Structure-activity relationships for ketamine esters as short-acting anaesthetics | journal = Bioorganic & Medicinal Chemistry | volume = 21 | issue = 17 | pages = 5098–106 | date = September 2013 | pmid = 23876339 | doi = 10.1016/j.bmc.2013.06.047 }}</ref><ref>{{cite journal | vauthors = Harvey M, Sleigh J, Voss L, Jose J, Gamage S, Pruijn F, Liyanage S, Denny W | display-authors = 6 | title = Development of Rapidly Metabolized and Ultra-Short-Acting Ketamine Analogs | journal = Anesthesia and Analgesia | volume = 121 | issue = 4 | pages = 925–33 | date = October 2015 | pmid = 25822925 | doi = 10.1213/ANE.0000000000000719 | s2cid = 23288200 | doi-access = free }}</ref><ref>{{cite journal | vauthors = Harvey M, Sleigh J, Voss L, Pruijn F, Jose J, Gamage S, Denny W | title = Determination of the Hypnotic Potency in Rats of the Novel Ketamine Ester Analogue SN 35210 | journal = Pharmacology | volume = 96 | issue = 5–6 | pages = 226–32 | year = 2015 | pmid = 26352278 | doi = 10.1159/000439598 | s2cid = 36017002 }}</ref><ref name="pmid30971208">{{cite journal | vauthors = Jacobson GM, Voss LJ, Klockars A, Bird S, Dimitrov I, Denny WA, Olszewski PK, Sleigh JW, Harvey MG | display-authors = 6 | title = Transcriptional changes in response to ketamine ester-analogs SN 35210 and SN 35563 in the rat brain | journal = BMC Genomics | volume = 20 | issue = 1 | pages = 281 | date = April 2019 | pmid = 30971208 | pmc = 6458767 | doi = 10.1186/s12864-019-5649-6 | doi-access = free }}</ref><ref name="pmid31856925">{{cite journal | vauthors = Harvey M, Sleigh J, Voss L, Bickerdike M, Dimitrov I, Denny W | title = KEA-1010, a ketamine ester analogue, retains analgesic and sedative potency but is devoid of Psychomimetic effects | journal = BMC Pharmacology & Toxicology | volume = 20 | issue = 1 | pages = 85 | date = December 2019 | pmid = 31856925 | doi = 10.1186/s40360-019-0374-y | pmc = 6923863 | doi-access = free }}</ref>

== See also == * A-NK

== References == {{Reflist}}

{{Dissociatives}} {{Ionotropic glutamate receptor modulators}}

Category:Arylcyclohexylamines Category:Dissociative drugs Category:NMDA receptor antagonists

{{Hallucinogen-stub}}