{{Short description|Chemical compound}} {{cs1 config|name-list-style=vanc|display-authors=6}} {{Infobox drug | drug_name = | INN = | type = <!-- empty --> | image = Rintodestrant.svg | image_class = skin-invert-image | width = | alt = | caption = | image2 = | width2 = | alt2 = | caption2 = | imageL = | widthL = | altL = | imageR = | widthR = | altR = | captionLR =
<!-- Clinical data --> | pronounce = | tradename = | Drugs.com = | MedlinePlus = | licence_CA = <!-- Health Canada may use generic or brand name (generic name preferred) --> | licence_EU = <!-- EMA uses INN (or special INN_EMA) --> | DailyMedID = <!-- DailyMed may use generic or brand name (generic name preferred) --> | licence_US = <!-- FDA may use generic or brand name (generic name preferred) --> | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_AU_comment = | pregnancy_category= | dependency_liability = | addiction_liability = | routes_of_administration = | class = | ATCvet = | ATC_prefix = <!-- 'none' if uncategorised --> | ATC_suffix = | ATC_supplemental =
<!-- Legal status --> | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled --> | legal_AU_comment = | legal_BR = <!-- OTC, A1, A2, A3, B1, B2, C1, C2, C3, C5, D1, D2, E, F1, F2, F3, F4 --> | legal_BR_comment = | legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_CA_comment = | legal_DE = <!-- Anlage I, II, III or Unscheduled --> | legal_DE_comment = | legal_NZ = <!-- Class A, B, C --> | legal_NZ_comment = | legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM / Class A, B, C --> | legal_UK_comment = | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_US_comment = | legal_EU = | legal_EU_comment = | legal_UN = <!-- N I, II, III, IV / P I, II, III, IV --> | legal_UN_comment = | legal_status = <!-- For countries not listed above -->
<!-- Pharmacokinetic data --> | bioavailability = | protein_bound = | metabolism = | metabolites = | onset = | elimination_half-life = | duration_of_action= | excretion =
<!-- Identifiers --> | CAS_number = 2088518-51-6 | CAS_supplemental = | PubChem = 129205616 | PubChemSubstance = | IUPHAR_ligand = | DrugBank = | ChemSpiderID = 76743881 | UNII = W3Y784Y0ES | KEGG = D11736 | ChEBI = | ChEMBL = 4059888 | NIAID_ChemDB = | PDB_ligand = | synonyms = G1T48
<!-- Chemical and physical data --> | IUPAC_name = <nowiki>(E)-3-[4-[2-(4-fluoro-2,6-dimethyl-benzoyl)-6-hydroxy-benzothiophen-3-yl]oxyphenyl]prop-2-enoic acid</nowiki> | C= 26 | H= 19 | F= 1 | O= 5 | S= 1 | molecular_weight = | SMILES = CC1=CC(=CC(=C1C(=O)C2=C(C3=C(S2)C=C(C=C3)O)OC4=CC=C(C=C4)/C=C/C(=O)O)C)F | Jmol = | StdInChI = InChI=1S/C26H19FO5S/c1-14-11-17(27)12-15(2)23(14)24(31)26-25(20-9-6-18(28)13-21(20)33-26)32-19-7-3-16(4-8-19)5-10-22(29)30/h3-13,28H,1-2H3,(H,29,30)/b10-5+ | StdInChI_comment = | StdInChIKey = KOAITBOFZOEDOC-BJMVGYQFSA-N | density = | density_notes = | melting_point = | melting_high = | melting_notes = | boiling_point = | boiling_notes = | solubility = | sol_units = | specific_rotation = }}
'''Rintodestrant (G1T48)''' is an orally bioavailable selective estrogen receptor degrader (SERD) discovered in Greg Thatcher's lab at UIC<ref>{{cite journal | vauthors = Xiong R, Zhao J, Gutgesell LM, Wang Y, Lee S, Karumudi B, Zhao H, Lu Y, Tonetti DA, Thatcher GR | title = Novel Selective Estrogen Receptor Downregulators (SERDs) Developed against Treatment-Resistant Breast Cancer | journal = Journal of Medicinal Chemistry | volume = 60 | issue = 4 | pages = 1325–1342 | date = February 2017 | pmid = 28117994 | doi = 10.1021/acs.jmedchem.6b01355 | pmc = 5786431 }}</ref> and developed by G1 Therapeutics for the treatment of estrogen receptor-positive (ER+) breast cancer.<ref>{{cite journal | vauthors = Andreano KJ, Wardell SE, Baker JG, Desautels TK, Baldi R, Chao CA, Heetderks KA, Bae Y, Xiong R, Tonetti DA, Gutgesell LM, Zhao J, Sorrentino JA, Thompson DA, Bisi JE, Strum JC, Thatcher GR, Norris JD | title = G1T48, an oral selective estrogen receptor degrader, and the CDK4/6 inhibitor lerociclib inhibit tumor growth in animal models of endocrine-resistant breast cancer | journal = Breast Cancer Research and Treatment | volume = 180 | issue = 3 | pages = 635–646 | date = April 2020 | pmid = 32130619 | doi = 10.1007/s10549-020-05575-9 | pmc = 7103015 }}</ref> Structurally inspired by the 6-OH-benzothiophene scaffold used in arzoxifene and raloxifene, rintodestrant selectively binds to the estrogen receptor and inhibits ER signaling, demonstrating efficacy in endocrine-resistant tumors.<ref name="Gheysen_2024">{{cite journal | vauthors = Gheysen M, Punie K, Wildiers H, Neven P | title = Oral SERDs changing the scenery in hormone receptor positive breast cancer, a comprehensive review | journal = Cancer Treatment Reviews | volume = 130 | issue = | article-number = 102825 | date = November 2024 | pmid = 39293125 | doi = 10.1016/j.ctrv.2024.102825 | doi-access = free }}</ref>
A phase I clinical trial evaluated rintodestrant as monotherapy and in combination with the CDK4/6 inhibitor palbociclib in patients with ER+/HER2- advanced breast cancer.<ref>{{ClinicalTrialsGov|NCT03455270|G1T48, an Oral SERD, Alone and in Combination With Palbociclib in ER-Positive, HER2-Negative Advanced Breast Cancer}}</ref>
== References == {{Reflist}}
Category:Antineoplastic drugs Category:Selective estrogen receptor degraders Category:Diaryl ethers Category:Benzothiophenes Category:Enoic acids Category:Fluorobenzene derivatives Category:Ketones Category:Phenols
{{antineoplastic-drug-stub}}