| Verifiedfields | changed |
|---|---|
| Watchedfields | changed |
| Verifiedrevid | 455170527 |
| Iupac name | 1-({(2R,3S)-5-chloro-3-(2-chlorophenyl)-1-[(3,4-dimethoxyphenyl)sulfonyl]-3-hydroxy-2,3-dihydro-1H-indol-2-yl}carbonyl)-L-prolinamide |
| Width | 220 |
| Iuphar ligand | 2200 |
| Cas number | 150375-75-0 |
| Atc prefix | none |
| Pubchem | 60943 |
| Chembl | 419667 |
| Unii | C1GL8G6G0O |
| Chemspiderid | 54910 |
| C | 28 |
| H | 27 |
| Cl | 2 |
| N | 3 |
| O | 7 |
| S | 1 |
| Smiles | COC1=C(C=C(C=C1)S(=O)(=O)N2[C@H]([C@](C3=C2C=CC(=C3)Cl)(C4=CC=CC=C4Cl)O)C(=O)N5CCC[C@H]5C(=O)N)OC |
| Stdinchi | 1S/C28H27Cl2N3O7S/c1-39-23-12-10-17(15-24(23)40-2)41(37,38)33-21-11-9-16(29)14-19(21)28(36,18-6-3-4-7-20(18)30)25(33)27(35)32-13-5-8-22(32)26(31)34/h3-4,6-7,9-12,14-15,22,25,36H,5,8,13H2,1-2H3,(H2,31,34)/t22-,25-,28+/m0/s1 |
| Stdinchikey | CEBYCSRFKCEUSW-NAYZPBBASA-N |
| Synonyms | (2S)-1-[(2R,3S)-5-chloro-3-(2-chlorophenyl)-1-(3,4-dimethoxyphenyl)sulfonyl-3-hydroxy-2H-indole-2-carbonyl]pyrrolidine-2-carboxamide |
Relcovaptan (SR-49059) is a non-peptide vasopressin receptor antagonist, selective for the V1A subtype.[1] It has shown positive initial results for the treatment of Raynaud syndrome and dysmenorrhoea, and as a tocolytic,[2] although it is not yet approved for clinical use.
References
- ^ Lemmens-Gruber R, Kamyar M (August 2006). "Vasopressin antagonists". Cellular and Molecular Life Sciences. 63 (15): 1766–79. doi:10.1007/s00018-006-6054-2. PMC 11136164. PMID 16794787. S2CID 30709102
- ^ Decaux G, Soupart A, Vassart G (May 2008). "Non-peptide arginine-vasopressin antagonists: the vaptans". Lancet. 371 (9624): 1624–32. doi:10.1016/S0140-6736(08)60695-9. PMID 18468546. S2CID 1245079