Racemoramide

{{Short description|Opioid analgesic racemic drug mixture}} {{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 448239916 | IUPAC_name = 3-methyl-4-morpholin-4-yl-2,2-diphenyl-1-pyrrolidin-1-yl-butan-1-one | image = Racemoramide.svg | image_class = skin-invert-image

| tradename = | pregnancy_category = | legal_BR = A1 | legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-04-04}}</ref> | legal_CA = Schedule I | legal_US = Schedule I | legal_DE = Anlage II | routes_of_administration =

| bioavailability = | metabolism = | excretion =

| CAS_number_Ref = {{cascite|changed|??}} | CAS_number = 545-59-5 | ATC_prefix = none | ATC_suffix = | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = L3J8QT828G | PubChem = 9648 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 9269 | smiles = O=C(N1CCCC1)C(c2ccccc2)(c3ccccc3)C(C)CN4CCOCC4 | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C25H32N2O2/c1-21(20-26-16-18-29-19-17-26)25(22-10-4-2-5-11-22,23-12-6-3-7-13-23)24(28)27-14-8-9-15-27/h2-7,10-13,21H,8-9,14-20H2,1H3 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = INUNXTSAACVKJS-UHFFFAOYSA-N

| C=25 | H=32 | N=2 | O=2 }}

'''Racemoramide''' (INN, BAN), or simply '''moramide''', is an opioid analgesic and a racemic mixture of the substances dextromoramide (the active component) and levomoramide (which is inactive), two enantiomers of a chiral molecule.<ref name="GanellinTriggle1997">{{cite book | vauthors = Ganellin CR, Triggle DJ, Macdonald F | title = Dictionary of pharmacological agents | url = https://books.google.com/books?id=A0THacd46ZsC&pg=PA1375 | accessdate = 29 November 2011 | year = 1997 | publisher = CRC Press | isbn = 978-0-412-46630-4 | page = 1375}}</ref>

Racemoramide is itself controlled; in the United States it is under Schedule I as a Narcotic with an ACSCN of 9645 and a zero annual aggregate manufacturing quota as of 2014.<ref name = "DEA">{{cite web | url = http://www.deadiversion.usdoj.gov/quotas/conv_factor/index.html | title = Conversion Factors for Controlled Substances | work = Diversion Control Division | publisher = Drug Enforcement Agency, U.S. Department of Justice | access-date = 2016-02-27 | archive-date = 2016-03-02 | archive-url = https://web.archive.org/web/20160302162948/http://deadiversion.usdoj.gov/quotas/conv_factor/index.html | url-status = dead }}</ref> Its salts are the bitartrate (free base conversion ratio 0.723) and dihydrochloride (0.843)

Moramide intermediate is listed separately as a Schedule II Narcotic controlled substance (ACSCN 9802), also with a zero quota.<ref name = "DEA" />

== References == {{Reflist}}

Category:4-Morpholinyl compounds Category:Opioids Category:Propionamides Category:1-Pyrrolidinyl compounds