{{Short description|Chemical compound}} {{Drugbox | verifiedrevid = 451560012 | IUPAC_name = 3,6,14-trihydroxy-4,5α-epoxy-17-(2-phenylethyl)morphinan | image = RAM-378.svg | image_class = skin-invert-image | width = 220
<!--Clinical data--> | tradename = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> | legal_US = | legal_status = | routes_of_administration =
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
<!--Identifiers--> | CAS_number_Ref = {{cascite|correct|CAS}} | CAS_number = 4778-96-5 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = JD4S8J3CMK | ATC_prefix = | ATC_suffix = | PubChem = 5492826 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank = | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 4591168 | synonyms =
<!--Chemical data--> | C=24 | H=27 | N=1 | O=4 | smiles = C1C[C@]2([C@H]3CC4=C5[C@@]2(CCN3CCC6=CC=CC=C6)[C@H]([C@H]1O)OC5=C(C=C4)O)O | StdInChI = 1S/C24H27NO4/c26-17-7-6-16-14-19-24(28)10-8-18(27)22-23(24,20(16)21(17)29-22)11-13-25(19)12-9-15-4-2-1-3-5-15/h1-7,18-19,22,26-28H,8-14H2/t18-,19+,22-,23-,24+/m0/s1 | StdInChIKey = GAHRZWMAHDWVCL-VKJMTUIMSA-N }}
'''RAM-378'''<ref>{{cite journal | vauthors = Ben Haddou T, Béni S, Hosztafi S, Malfacini D, Calo G, Schmidhammer H, Spetea M | title = Pharmacological investigations of N-substituent variation in morphine and oxymorphone: opioid receptor binding, signaling and antinociceptive activity | journal = PLOS ONE | volume = 9 | issue = 6 | article-number = e99231 | date = 2014 | pmid = 24919067 | pmc = 4053365 | doi = 10.1371/journal.pone.0099231 | bibcode = 2014PLoSO...999231B | doi-access = free }}</ref>('''7,8-Dihydro-14-hydroxy-N-phenethylnormorphine''') is an opioid analgesic. It is the N-phenethyl derivative of hydromorphinol.
==See also== * 14-Cinnamoyloxycodeinone * 14-Phenylpropoxymetopon * 7-PET * N-Phenethylnormorphine * N-Phenethyl-14-ethoxymetopon * Phenomorphan * Ro4-1539
==References== {{Reflist|2}}
{{Opioidergics}}
Category:4,5-Epoxymorphinans Category:Semisynthetic opioids
{{Analgesic-stub}}