{{Chembox | Verifiedfields = | verifiedrevid = | Name = Punicacortein B | ImageFile = Punicacortein B.PNG | ImageSize = 228px | ImageName = Chemical structure of punicacortein B | IUPACName = (2R,3R)-3-[(14S,15S,19S)-2,3,4,7,8,9,19-Heptahydroxy-12,17-dioxo-13,16-dioxatetracyclo[13.3.1.0<sup>5,18</sup>.0<sup>6,11</sup>]nonadeca-1(18),2,4,6,8,10-hexaen-14-yl]-2,3-dihydroxypropyl 3,4,5-trihydroxybenzoate | OtherNames = |Section1={{Chembox Identifiers | CASNo = 103488-36-4 | CASNo_Ref = {{Cascite|changed|CAS}} | PubChem = 20056239 | ChEMBL_Ref = | ChEMBL = | ChemSpiderID = 16738326 | SMILES = Oc1cc(cc(O)c1O)C(=O)OC[C@@H](O)[C@@H](O)[C@@H]5OC(=O)c2cc(O)c(O)c(O)c2c3c(O)c(O)c(O)c4[C@H](O)[C@@H]5OC(=O)c34 | InChIKey = 1S/C27H22O18/c28-7-1-5(2-8(29)15(7)32)25(40)43-4-10(31)17(34)23-24-21(38)14-13(27(42)45-24)12(19(36)22(39)20(14)37)11-6(26(41)44-23)3-9(30)16(33)18(11)35/h1-3,10,17,21,23-24,28-39H,4H2/t10-,17-,21+,23+,24+/m1/s1 | InChIKey2 = JYPJJOONMBTTAR-MEZSAOBOSA-N }} |Section2={{Chembox Properties | Formula = C<sub>27</sub>H<sub>22</sub>O<sub>18</sub> | MolarMass = 634.43 g/mol | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}{{One source|date=December 2025}} '''Punicacortein B''' is an ellagitannin, a polyphenol compound. It is found in the bark of ''Punica granatum'' (pomegranate).<ref>Tannins and Related Compounds. XLI. : Isolation and Characterization of Novel Ellagitannins, Punicacorteins A, B, C, and D, and Punigluconin from the Bark of Punica granatum L. Tanaka Takashi, Nonaka Gen-Ichiro and Nishioka Itsuo, Chemical & Pharmaceutical Bulletin, 1986-02-25, 34(2), pages 656-663 ([http://ci.nii.ac.jp/naid/110003626133/ abstract])</ref>
== References == <references/>
<!--== External links ==-->
{{ellagitannin}} {{Pomegranate ellagitannin}}
Category:Pomegranate ellagitannins Category:Heterocyclic compounds with 4 rings Category:Esters
{{aromatic-stub}}