Pterocarpin

{{refimprove|date=June 2023}} {{Chembox | ImageFile = Pterocarpin.svg | ImageSize = 250px | ImageAlt = Chemical structure of pterocarpin | IUPACName = | OtherNames = (−)-Pterocarpin<br>3-Methoxy-8,9-methylenedioxypterocarpan |Section1={{Chembox Identifiers | CASNo = 524-97-0 | CASNo_Ref = {{cascite|correct|CAS}} | ChemSpiderID = 1363798 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = NZ7T2XO0S1 | PubChem = 1715306 | InChI=1S/C17H14O5/c1-18-9-2-3-10-13(4-9)19-7-12-11-5-15-16(21-8-20-15)6-14(11)22-17(10)12/h2-6,12,17H,7-8H2,1H3/t12-,17-/m0/s1 | InChIKey = YLZYAUCOYZKLMA-SJCJKPOMSA-N | SMILES = O(C)C=1C=C2C([C@]3([C@](C=4C(O3)=CC5=C(C4)OCO5)(CO2)[H])[H])=CC1 }} |Section2={{Chembox Properties | C = 17 | H = 14 | O = 5 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }} '''Pterocarpin''' is a pterocarpan found in the Fabaceae species ''Baphia nitida'', ''Ononis viscosa subsp. breviflora'', ''Pterocarpus spp.'', ''Sophora angustifolia'', ''Sophora substrata'' and ''Swartzia madagascariensis''.<ref>{{Cite web |url=http://kanaya.naist.jp/knapsack_jsp/information.jsp?mode=r&word=C00009616&key=5 |title=Pterocarpin at knapsack_jsp |access-date=2013-02-05 |archive-url=https://web.archive.org/web/20140222201449/http://kanaya.naist.jp/knapsack_jsp/information.jsp?mode=r&word=C00009616&key=5 |archive-date=2014-02-22 |url-status=dead }}</ref>

== References == {{Reflist}}

Category:Pterocarpans Category:Heterocyclic compounds with 5 rings Category:Methoxy compounds