{{Short description|Chemical compound}} {{Drugbox | IUPAC_name = <nowiki>4-[2-[[2-(1,3-Benzodioxol-5-yl)-1-methyl-ethyl]amino]-1-hydroxy-ethyl]benzene-1,2-diol</nowiki> | image = Protokylol.svg | image_class = skin-invert-image
<!--Clinical data--> | tradename = Ventaire | pregnancy_category = | legal_status = Rx-only | routes_of_administration = | class = β-Adrenergic receptor agonist; Bronchodilator
<!--Pharmacokinetic data--> | bioavailability = | metabolism = | elimination_half-life = | excretion =
<!--Identifiers--> | CAS_number = 136-70-9 | ATC_prefix = None | ATC_suffix = | PubChem = 4969 | ChemSpiderID = 4798 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 8Y5Y4EEO2V | ChEMBL = 1201273
<!--Chemical data--> | C=18 | H=21 | N=1 | O=5 | smiles = O1c2ccc(cc2OC1)CC(NCC(O)c3ccc(O)c(O)c3)C }}
'''Protokylol''', sold under the brand name '''Ventaire''', is a β-adrenergic receptor agonist used as a bronchodilator in Europe and the United States.<ref name="isbn3-88763-075-0">{{cite book | author = Swiss Pharmaceutical Society | title = Index Nominum 2000: International Drug Directory (Book with CD-ROM) | publisher = Medpharm Scientific Publishers | location = Boca Raton | year = 2000 | isbn = 3-88763-075-0 | url = https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA894}}</ref>{{failed verification|date=February 2020}}
It is methylenedioxyphenyl-isoproterenol.
The Para-Methoxyamphetamine (PMA) analog is twice the potency as the tenamfetamine analog.<ref name="BielSchwarz1954">{{cite journal| vauthors = Biel JH, Schwarz EG, Sprengeler EP, Leiser HA, Friedman HL |title=Bronchodilators, N-Substituted Derivatives of 1-(3',4'-Dihydroxyphenyl)-2-aminoethanol (Arterenol)|journal=Journal of the American Chemical Society|volume=76|issue=12|year=1954|pages=3149–3153|issn=0002-7863|doi=10.1021/ja01641a010}}</ref>
==See also== * Substituted methylenedioxyphenethylamine
== References == {{Reflist}}
== External links == * {{cite web| url = https://druginfo.nlm.nih.gov/drugportal/name/protokylol | archive-url = https://web.archive.org/web/20200205031156/https://druginfo.nlm.nih.gov/drugportal/name/protokylol | url-status = dead | archive-date = February 5, 2020 | publisher = U.S. National Library of Medicine| work = Drug Information Portal | title = Protokylol }}
{{Asthma_and_copd_rx}} {{Adrenergics}} {{Phenethylamines}} {{Portal bar | Medicine}}
Category:Catechols Category:Methylenedioxyamphetamines Category:Phenylethanolamines
{{respiratory-system-drug-stub}}